
CAS Number127972-02-5
Synonyms5-ForMyl-2-Methoxyphenylboronic Acid; 5-Formyl-2-methoxybenzeneboronic Acid; (5-Formyl-2-methoxyphenyl)boronic acid; MFCD01319044
Molecular FormulaC8H9BO4
Molecular Weight179.966
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point417.4±55.0 °C at 760 mmHg
Melting Point154-157 °C(lit.)
Appearancelight orange powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 127972-02-5 |
| Catalog No. | 2A-9051861 |
| Chinese Name | 5-醛基-2-甲氧基苯硼酸 |
| Synonyms | 5-ForMyl-2-Methoxyphenylboronic Acid; 5-Formyl-2-methoxybenzeneboronic Acid; (5-Formyl-2-methoxyphenyl)boronic acid; MFCD01319044 |
| Molecular Formula | C8H9BO4 |
| Molecular Weight | 179.966 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 417.4±55.0 °C at 760 mmHg |
| Melting Point | 154-157 °C(lit.) |
| Appearance | light orange powder |
| Storage Condition | Seal and store at 0-6 ºC |
| HTC | 2931900090 |
| SMILES | COc1ccc(C=O)cc1B(O)O |
| InChI | InChI=1S/C8H9BO4/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-5,11-12H,1H3 |
| InChI Key | NKKNXLPHCRLBDY-UHFFFAOYSA-N |
| Hazard Symbols | 8.0 |
| MSDS | msds/51861_1_127972_02_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Methoxymethylphenylboronic acid | 126617-98-9 | 2A-9051752 |
| Cyclopropylboronic acid pinacol ester | 126689-01-8 | 2A-9051760 |
| Isopropenylboronic acid pinacol ester | 126726-62-3 | 2A-9051766 |
| 4-(Pyridin-3-yl)benzaldehyde | 127406-55-7 | 2A-9051823 |
| 2-Methoxy-5-methylphenylboronic acid | 127972-00-3 | 2A-9051860 |
| N-Ethyl-N-ethoxylethyl-4-amino-2-methyl benzaldehyde | 128237-47-8 | 2A-9051880 |
| 4-Formylphenylboronic acid pinacol cyclic ester | 128376-64-7 | 2A-9051892 |
| 4-(5,5-Dimethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 128376-65-8 | 2A-9051893 |
| (3,5-Diphenylphenyl)boronic acid | 128388-54-5 | 2A-9051894 |
| Methyl 2-bromo-4-bromomethylbenzoate | 128577-48-0 | 2A-9051913 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA