
CAS Number175278-23-6
Synonyms4-Amino-3-trifluoromethoxybenzonitrile; MFCD00204177; 4-Amino-3-(trifluoromethoxy)benzonitrile
Molecular FormulaC8H5F3N2O
Molecular Weight202.133
Purity97%
Density1.4±0.1 g/cm3
Boiling Point248.6±40.0 °C at 760 mmHg
Melting Point72 °C
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175278-23-6 |
| Catalog No. | 2A-9005119 |
| Chinese Name | 4-氨基-3-三氟甲氧基苯甲腈 |
| Synonyms | 4-Amino-3-trifluoromethoxybenzonitrile; MFCD00204177; 4-Amino-3-(trifluoromethoxy)benzonitrile |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.133 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 248.6±40.0 °C at 760 mmHg |
| Melting Point | 72 °C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Room temperature, dry |
| HTC | 2926909090 |
| SMILES | N#Cc1ccc(N)c(OC(F)(F)F)c1 |
| InChI Key | QNJPSMLILRHZOW-UHFFFAOYSA-N |
| MSDS | msds/5119_1_175278_23_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-2-fluorobenzotrifluoride | 69411-68-3 | 2A-9005110 |
| 4-Amino-2-fluorophenol | 399-96-2 | 2A-9005111 |
| 4-Amino-2-methyl-10H-thieno(2,3-b)(1,5)-benzodiazepine | 2A-105114 | 2A-9005114 |
| 4-Amino-2-methylphenol | 2635-95-2 | 2A-9005115 |
| 4-Amino-3-(trifluoromethoxy)benzoic acid | 175278-22-5 | 2A-9005118 |
| 4-Amino-3,5-dibromobenzoic acid | 4123-72-2 | 2A-9005123 |
| 4-Amino-3,5-dibromobenzotrifluoride | 72678-19-4 | 2A-9005124 |
| 4-Amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid | 69377-81-7 | 2A-9005126 |
| 4-Amino-3,5-dichloroacetophenone | 37148-48-4 | 2A-9005127 |
| 4-Amino-3,5-dinitrobenzotrifluoride | 445-66-9 | 2A-9005129 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA