
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 399-96-2 |
| Catalog No. | 2A-9005111 |
| Chinese Name | 4-氨基-2-氟苯酚 |
| Synonyms | 4-Amino-2-fluorophenol; 3-Fluoro-4-hydroxyaniline; ZR DQ CF; MFCD00671760 |
| Molecular Formula | C6H6O1N1F1 |
| Molecular Weight | 127.12 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 263.3±25.0 °C at 760 mmHg |
| Melting Point | 170-172°C |
| Storage Condition | Room Temperature |
| HTC | 2907111000 |
| MDL Number | MFCD00671760 |
| SMILES | Nc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C6H6FNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2 |
| InChI Key | MXJQJURZHQZLNN-UHFFFAOYSA-N |
| MSDS | msds/5111_1_399_96_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-2,3-difluorobenzotrifluoride | 123950-46-9 | 2A-9005096 |
| 4-Amino-2,5-difluorobenzotrifluoride | 114973-22-7 | 2A-9005097 |
| 4-Amino-2,5-difluorophenol | 120103-19-7 | 2A-9005098 |
| 4-Amino-2,6-dichloro-alpha-(4-chlorophenyl)phenzyl cyanide | 2A-105099 | 2A-9005099 |
| 4-Amino-2-fluorobenzotrifluoride | 69411-68-3 | 2A-9005110 |
| 4-Amino-2-methyl-10H-thieno(2,3-b)(1,5)-benzodiazepine | 2A-105114 | 2A-9005114 |
| 4-Amino-2-methylphenol | 2635-95-2 | 2A-9005115 |
| 4-Amino-3-(trifluoromethoxy)benzoic acid | 175278-22-5 | 2A-9005118 |
| 4-Amino-3-(trifluoromethoxy)benzonitrile | 175278-23-6 | 2A-9005119 |
| 4-Amino-3,5-dibromobenzoic acid | 4123-72-2 | 2A-9005123 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA