
CAS Number113507-06-5
SynonymsEquest; Vetdectin Oral Drench; proheart; ProHeart 6; Moxidectin HOUSE STANDARD; Moxidectin; Quest
Molecular FormulaC37H53NO8
Molecular Weight639.82
Purity97.00%
Density1.2±0.1 g/cm3
Boiling Point790.0±70.0 °C at 760 mmHg
Melting Point132 °C
AppearanceSolid;White to Almost white powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 113507-06-5 |
| Catalog No. | 2A-9050768 |
| Chinese Name | 莫西菌素 |
| Synonyms | Equest; Vetdectin Oral Drench; proheart; ProHeart 6; Moxidectin HOUSE STANDARD; Moxidectin; Quest |
| Molecular Formula | C37H53NO8 |
| Molecular Weight | 639.82 |
| Purity | 97.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 790.0±70.0 °C at 760 mmHg |
| Melting Point | 132 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | 2-8°C |
| Packaging | III |
| Application | Moxidectin (ProHeart 6; CL301423; Cydectin) is an anthelmintic used to prevent and control heartworms and roundworms. |
| HTC | 29322090 |
| PubChem ID | 329754646 |
| MDL Number | MFCD00866560 |
| SMILES | CO\N=C1/C[C@]2(C[C@@H]3CC(C\C=C(C)\C[C@@H](C)\C=C\C=C4/COC5[C@H](O)C(C)=C[C@@H](C(=O)O3)[C@]45O)O2)O[C@@H]([C@H]1C)\C(C)=C\C(C)C |
| InChI | 1S/C37H53NO8/c1-21(2)14-25(6)33-26(7)31(38-42-8)19-36(46-33)18-29-17-28(45-36)13-12-23(4)15-22(3)10-9-11-27-20-43-34-32(39)24(5)16-30(35(40)44-29)37(27,34)41/h9-12,14,16,21-22,26,28-30,32-34,39,41H,13,15,17-20H2,1-8H3/b10-9+,23-12+,25-14+,27-11+,38-31+/t22-,26-,28+,29-,30-,32+,33+,34+,36-,37+/m0/s1 |
| InChI Key | YZBLFMPOMVTDJY-LSGXYNIPSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/50768_1_113507_06_5.pdf |
| Transport Info | Product Name: Moxidectin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6,8-Dichloro-2-tetralone | 113075-86-8 | 2A-9050739 |
| 1-Chloro-1,2,3,4-tetrahydronaphthalene | 113110-47-7 | 2A-9050742 |
| 2-Chloro-3-methoxyaniline | 113206-03-4 | 2A-9050752 |
| Hirudin | 113274-56-9 | 2A-9050757 |
| 4,4',4''-Methylidenetrisbenzonitrile | 113402-31-6 | 2A-9050765 |
| 1-Phenyl-3-(pyrrolidin-1-yl)propan-1-amine | 113640-37-2 | 2A-9050771 |
| N3,N3-Diethyl-1-phenyl-1,3-propanediamine | 113640-41-8 | 2A-9050772 |
| Fura 2 pentapotassium | 113694-64-7 | 2A-9050774 |
| Olopatadine | 113806-05-6 | 2A-9050783 |
| (2R)-(-)-Glycidyl tosylate | 113826-06-5 | 2A-9050785 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA