
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100189-17-1 |
| Catalog No. | 2A-9049694 |
| Chinese Name | 6-甲基-3-吡啶乙醇 |
| Synonyms | 2-(6-methylpyridin-3-yl)ethanol |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 |
| Purity | 98.00 |
| Density | 1.061g/cm3 |
| Boiling Point | 246.739ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933399090 |
| PubChem ID | 36730919 |
| SMILES | Cc1ccc(CCO)cn1 |
| InChI | InChI=1S/C8H11NO/c1-7-2-3-8(4-5-10)6-9-7/h2-3,6,10H,4-5H2,1H3 |
| InChI Key | CRZJKFRQNPDUIV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Phenyl-1,3-oxazole-4-carboxylic acid | 99924-18-2 | 2A-9049675 |
| 4-Amino-2-methylquinoline-6-carboxylic acid | 99984-73-3 | 2A-9049677 |
| 4-Aminopyridine-2-carboxylic acid | 100047-36-7 | 2A-0202234 |
| 1-Methyl-6-oxo-1,6-dihydropyridazine-3-carboxylic acid | 100047-66-3 | 2A-9049681 |
| 5-Methyl-2-(methylthio)pyrimidine | 100114-24-7 | 2A-9049686 |
| Methyl azetidine-3-carboxylate hydrochloride | 100202-39-9 | 2A-9049696 |
| Quinoline Yellow | 100208-62-6 | 2A-9049697 |
| 2-Acetamido-5-fluoropyridine | 100304-88-9 | 2A-9049703 |
| 4-(Benzylamino)-3-nitropyridine | 100306-70-5 | 2A-9049705 |
| N-tert-Butyl-2-thiophenesulfonamide | 100342-30-1 | 2A-9049707 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA