
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99174-91-1 |
| Catalog No. | 2A-9049587 |
| Chinese Name | 2-溴-2-丙基戊酸乙酯 |
| Synonyms | 2-Brom-2-propyl-valeriansaeure-aethylester; 2-bromo-2-propyl-valeric acid ethyl ester; 2-bromo-2-propyl pentanoic acid ethyl ester; 2-Brom-2-propyl-pentansaeure-ethylester |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 294.14 |
| Purity | 98.00 |
| Appearance | solid |
| HTC | 2915900090 |
| PubChem ID | 329773525 |
| MDL Number | MFCD09787812 |
| SMILES | CCOC(=O)c1cc2cc(Br)ccc2nc1C |
| InChI | 1S/C13H12BrNO2/c1-3-17-13(16)11-7-9-6-10(14)4-5-12(9)15-8(11)2/h4-7H,3H2,1-2H3 |
| InChI Key | WOWPFIGSWCNAHK-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/49587_1_99174_91_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Flumetsulam | 98967-40-9 | 2A-9049567 |
| 3-Aminotropane | 98998-25-5 | 2A-9049572 |
| 2-Phenyl-3-aminopropionic acid methyl ester | 99092-02-1 | 2A-9049580 |
| Clethodim | 99129-21-2 | 2A-9049583 |
| N-Methyl-2-oxazolamine | 99170-93-1 | 2A-9049586 |
| 1,3,5-Adamantanetriol | 99181-50-7 | 2A-9049588 |
| 6-Fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | 99199-90-3 | 2A-9049593 |
| 10-(2,5-Dihydroxyphenyl)-10H-9-oxa-10-phospha-phenantbrene-10-oxide | 99208-50-1 | 2A-9049595 |
| Levodropropizine | 99291-25-5 | 2A-9049601 |
| 3-Bromo-D-phenylalanine | 99295-78-0 | 2A-9049604 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA