
CAS Number98349-24-7
SynonymsBenzenepropanoic acid, 2,4,5-trifluoro-β-oxo-, ethyl ester; MFCD00792431; Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate
Molecular FormulaC11H9F3O3
Molecular Weight246.19
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point283.1±35.0 °C at 760 mmHg
Melting Point66-68ºC
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 98349-24-7 |
| Catalog No. | 2A-9049498 |
| Chinese Name | 2,4,5-三氟苯甲酰乙酸乙酯 |
| Synonyms | Benzenepropanoic acid, 2,4,5-trifluoro-β-oxo-, ethyl ester; MFCD00792431; Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.19 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 283.1±35.0 °C at 760 mmHg |
| Melting Point | 66-68ºC |
| Appearance | white solid |
| Storage Condition | room temperature, dry |
| HTC | 2916399090 |
| PubChem ID | 3186141 |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H9F3O3/c1-2-17-11(16)5-10(15)6-3-8(13)9(14)4-7(6)12/h3-4H,2,5H2,1H3 |
| InChI Key | OTCJYVJORKMTHX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Primisulfuron-methyl | 86209-51-0 | 2A-9049335 |
| 2-[[(2,4-Difluorophenyl)-2-oxiranyl]methyl]-1H-1,2,4-triazole methanesulfonate | 86386-77-8 | 2A-9049351 |
| 3,5-Dimethylpyrrole-2,4-dicarboxylic acid 2-t-butyl ester-4-ethyl ester | 86770-31-2 | 2A-9049401 |
| Haloxyfop-etotyl | 87237-48-7 | 2A-9049449 |
| 4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile | 87388-06-5 | 2A-9049465 |
| 2,4-Dichloro-5-methoxyaniline | 98446-49-2 | 2A-9049510 |
| Benoxacor | 98730-04-2 | 2A-9049543 |
| Sulcotrione | 99105-77-8 | 2A-9049582 |
| 4-[[5,7-dihydroxy-2,2-dimethyl-8-(2-methylpropanoyl)chromen-6-yl]methy l]-3,5-dihydroxy-6,6-dimethyl-2-(2-methylpropanoyl)cyclohexa-2,4-dien- 1-one | 10-00-4 | 2A-9049590 |
| Bensulfuron | 99283-01-9 | 2A-9049599 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA