
CAS Number86479-06-3
SynonymsHexafluron; Hexaflumuron; N-{[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl}-2,6-difluorobenzamide; OMS-3031; N-[[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide; CONSULT; DE-473; MFCD01743935; 1-[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(2,6-difluorobenzoyl)urea; Trueno; xrd473; CONSOL; hexafluoron
Molecular FormulaC16H8Cl2F6N2O3
Molecular Weight461.14
Purity98.00%
Density1.6±0.1 g/cm3
Melting Point202-205ºC
AppearanceColorless solid or white powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86479-06-3 |
| Catalog No. | 2A-9049364 |
| Chinese Name | 氟铃脲 |
| Synonyms | Hexafluron; Hexaflumuron; N-{[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl}-2,6-difluorobenzamide; OMS-3031; N-[[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide; CONSULT; DE-473; MFCD01743935; 1-[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(2,6-difluorobenzoyl)urea; Trueno; xrd473; CONSOL; hexafluoron |
| Molecular Formula | C16H8Cl2F6N2O3 |
| Molecular Weight | 461.14 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Melting Point | 202-205ºC |
| Appearance | Colorless solid or white powder |
| Storage Condition | 0-6°C |
| Packaging | III |
| Application | Hexazinone is a non-selective herbicide of the triazine family. Hexazinone binds to the D-1 quinone protein of the photosystem II electron transport chain, inhibiting photosynthesis. |
| PubChem ID | 7816080 |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(OC(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl2F6N2O3/c17-7-4-6(5-8(18)12(7)29-16(23,24)14(21)22)25-15(28)26-13(27)11-9(19)2-1-3-10(11)20/h1-5,14H,(H2,25,26,27,28) |
| InChI Key | RGNPBRKPHBKNKX-UHFFFAOYSA-N |
| Hazard Symbols | 9 |
| Transport Info | Product name: Flufenuron |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-Diacetoxy-2-(acetoxymethoxy)propane | 86357-13-3 | 2A-9049347 |
| 2-Amino-3,5-dibromobenzenemethanamine | 86379-71-7 | 2A-9049349 |
| 16alpha-Hydroxyprednisonlone acetate | 86401-80-1 | 2A-9049356 |
| Ecabet sodium | 76194-94-9 | 2A-9049360 |
| Mildronate dihydrate | 86426-17-7 | 2A-9049361 |
| 1-(2',4',6'-Trichlorophenyl)-3-(2'-chloro-5'-aminoanilino)-5-pyrazolone | 86491-51-2 | 2A-9049368 |
| 3-Chloro-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one | 86499-23-2 | 2A-9049369 |
| 3-Amino-2,3,4,5-Tetrahydro-1H-1-benzazepin-2-one | 86499-35-6 | 2A-9049370 |
| alpha-[(2,3,4,5-Tetrahydro-2-oxo-1H-1-benzazepin-3-yl)amino]benzenebutanoic acid ethyl ester | 86499-39-0 | 2A-9049371 |
| 4-(4-Methylpiperazino)benzoic acid | 86620-62-4 | 2A-9049384 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA