
CAS Number85858-95-3
Synonyms7-Methoxy-1,2,3,4-tetrahydro-[1]naphthoesaeure; (R,S)-7-methoxy-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid; 7-methoxy-1,2,3,4-tetrahydro-1-naphthylcarboxylic acid; 7-methoxy-1,2,3,4-tetrahydro-[1]naphthoic acid; 1,2,3,4-TETRAHYDRO-7-METHOXY-1-NAPHTHALENECARBOXYLIC ACID; 7-Methoxy-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid; 7-methoxy-3,4-dihydronaphthalen-1-yl-carboxylic acid
Molecular FormulaC12H14O3
Molecular Weight206.24
Purity98.00%
Density1.195g/cm3
Boiling Point374.977ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85858-95-3 |
| Catalog No. | 2A-9049284 |
| Chinese Name | 1,2,3,4-四氢-7-甲氧基-1-萘甲酸 |
| Synonyms | 7-Methoxy-1,2,3,4-tetrahydro-[1]naphthoesaeure; (R,S)-7-methoxy-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid; 7-methoxy-1,2,3,4-tetrahydro-1-naphthylcarboxylic acid; 7-methoxy-1,2,3,4-tetrahydro-[1]naphthoic acid; 1,2,3,4-TETRAHYDRO-7-METHOXY-1-NAPHTHALENECARBOXYLIC ACID; 7-Methoxy-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid; 7-methoxy-3,4-dihydronaphthalen-1-yl-carboxylic acid |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| Purity | 98.00 |
| Density | 1.195g/cm3 |
| Boiling Point | 374.977ºC at 760 mmHg |
| HTC | 2918990090 |
| PubChem ID | 38279374 |
| MDL Number | MFCD06659045 |
| SMILES | COc1ccc2c(c1)C(C(=O)O)CCC2 |
| InChI | InChI=1S/C12H14O3/c1-15-9-6-5-8-3-2-4-10(12(13)14)11(8)7-9/h5-7,10H,2-4H2,1H3,(H,13,14) |
| InChI Key | WJNRAOKRAWFGFS-UHFFFAOYSA-N |
| MSDS | msds/49284_1_85858_95_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Methoxycarbonyl-2-nitrophenylboronic acid | 85107-55-7 | 2A-9049186 |
| 2,5-Dimethylphenylboronic acid | 85199-06-0 | 2A-9049205 |
| 4-Hydroxy-2,5-dimethylbenzaldehyde | 85231-15-8 | 2A-9049209 |
| [1,2-Ethanediylbis[nitrilobis(methylene)]]tetrakisphosphonic acid calcium sodium salt | 85480-89-3 | 2A-9049244 |
| 2-Chloro-6-(trifluoromethyl)pyrimidin-4-amine | 85730-36-5 | 2A-9049278 |
| 2-(Chloromethyl)benzoic acid | 85888-81-9 | 2A-9049285 |
| 5-Chloro-2,3-dimethoxybenzaldehyde | 86232-28-2 | 2A-9049336 |
| Cyclohexylboronic acid pinacol ester | 87100-15-0 | 2A-9049430 |
| 2-Hydroxymethylphenylboronic acid | 87199-14-2 | 2A-9049437 |
| 3-Hydroxyphenylboronic acid | 87199-18-6 | 2A-9049441 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA