
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85231-15-8 |
| Catalog No. | 2A-9049209 |
| Chinese Name | 2,5-二甲基-4-羟基苯甲醛 |
| Synonyms | 4-Hydroxy-2,5-dimethyl-benzaldehyde; 4-Hydroxy-2,5-dimethylbenzaldehyde |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 |
| Purity | 99.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 272.7±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2912499000 |
| PubChem ID | 37460225 |
| SMILES | Cc1cc(C=O)c(C)cc1O |
| InChI | InChI=1S/C9H10O2/c1-6-4-9(11)7(2)3-8(6)5-10/h3-5,11H,1-2H3 |
| InChI Key | XLIMLVMYIYSMIQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Aminophenylboronic acid hydrochloride | 85006-23-1 | 2A-0201170 |
| 3,5-Bis(trifluoromethyl)benzylamine | 85068-29-7 | 2A-9049166 |
| 4-Carboxy-2-nitrophenylboronic acid | 85107-54-6 | 2A-9049185 |
| 4-Methoxycarbonyl-2-nitrophenylboronic acid | 85107-55-7 | 2A-9049186 |
| 2,5-Dimethylphenylboronic acid | 85199-06-0 | 2A-9049205 |
| [1,2-Ethanediylbis[nitrilobis(methylene)]]tetrakisphosphonic acid calcium sodium salt | 85480-89-3 | 2A-9049244 |
| 2-Chloro-6-(trifluoromethyl)pyrimidin-4-amine | 85730-36-5 | 2A-9049278 |
| 1,2,3,4-Tetrahydro-7-methoxy-1-naphthalenecarboxylic acid | 85858-95-3 | 2A-9049284 |
| 2-(Chloromethyl)benzoic acid | 85888-81-9 | 2A-9049285 |
| 5-Chloro-2,3-dimethoxybenzaldehyde | 86232-28-2 | 2A-9049336 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA