
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85095-61-0 |
| Catalog No. | 2A-9049180 |
| Chinese Name | 防黄剂 HN-150 |
| Synonyms | P015 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.44900 |
| Purity | 98.00 |
| Density | 1.234 g/cm3 |
| Melting Point | 177ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | room temperature |
| HTC | 2928000090 |
| PubChem ID | 37491988 |
| SMILES | CN(C)NC(=O)Nc1ccc(Cc2ccc(NC(=O)NN(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H26N6O2/c1-24(2)22-18(26)20-16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)21-19(27)23-25(3)4/h5-12H,13H2,1-4H3,(H2,20,22,26)(H2,21,23,27) |
| InChI Key | AQABZFKTYXFIJF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lithium bromide | 85017-82-9 | 2A-9049159 |
| 2-Chloropropionylglycine | 85038-45-5 | 2A-9049161 |
| [2R-(2a,3b,11bb)]-1,3,4,6,7,11b-Hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-ol | 85081-18-1 | 2A-9049175 |
| Kidney Bean Extract | 85085-22-9 | 2A-9049176 |
| Clover extract | 85085-25-2 | 2A-9049177 |
| 1-(4'-Bromobiphenyl-4-yl)-3-phenylpropenone | 85098-88-0 | 2A-0201602 |
| 1-Butyl-3-methylimidazolium bromide | 85100-77-2 | 2A-9049183 |
| (-)-Diisopinocampheyl chloroborane | 85116-37-6 | 2A-9049188 |
| WCA-80 | 35430-88-7 | 2A-9049190 |
| 3,4-Difluorobenzyl alcohol | 85118-05-4 | 2A-9049193 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA