![[2R-(2a,3b,11bb)]-1,3,4,6,7,11b-Hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-ol structure, CAS 85081-18-1](/structures/60000/49175_1_85081_18_1.png)
CAS Number85081-18-1
Synonyms(+)-dihydrotetrabenzaine; trans-2 hydroxy-3 isobutyl-9,10 dimethoxy-1,2,3,4,6,7 hexahydro-11bH-benzo(a)quinolizine; 2H-Benzo[a]quinolizin-2-ol,1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-,(2R,3R,11bR); (Â-)-dihydrotetrabenazine; (2S,3S,11bS)-3-Isobutyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-ol; WEQLWGNDNRARGE-DJIMGWMZSA; NBI-98782
Molecular FormulaC19H29NO3
Molecular Weight319.44
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point457.8±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85081-18-1 |
| Catalog No. | 2A-9049175 |
| Chinese Name | NBI-98782 |
| Synonyms | (+)-dihydrotetrabenzaine; trans-2 hydroxy-3 isobutyl-9,10 dimethoxy-1,2,3,4,6,7 hexahydro-11bH-benzo(a)quinolizine; 2H-Benzo[a]quinolizin-2-ol,1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-,(2R,3R,11bR); (Â-)-dihydrotetrabenazine; (2S,3S,11bS)-3-Isobutyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-ol; WEQLWGNDNRARGE-DJIMGWMZSA; NBI-98782 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 457.8±45.0 °C at 760 mmHg |
| Storage Condition | 2-8℃ |
| Application | NBI-98782 (alpha-dihydrotetrabenazine) is a vesicular monoamine transporter (VMAT2) inhibitor with a Ki of 0.97nM. |
| PubChem ID | 42617958 |
| MDL Number | C19H29NO3 |
| SMILES | COc1cc2c(cc1OC)C1CC(O)C(CC(C)C)CN1CC2 |
| InChI | InChI=1S/C19H29NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16-17,21H,5-7,10-11H2,1-4H3/t14-,16-,17-/m1/s1 |
| InChI Key | WEQLWGNDNRARGE-DJIMGWMZSA-N |
| MSDS | msds/49175_1_85081_18_1.pdf |
| Transport Info | Product name: NBI-98782 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Hydroxypentanoic acid cyclohexylamide | 84996-93-0 | 2A-9049153 |
| 4-Propylphenyl 4-(trans-4-pentylcyclohexyl)benzoate | 85005-66-9 | 2A-9049154 |
| 2-Chloro-5-methoxyaniline hydrochloride | 85006-21-9 | 2A-9049155 |
| Lithium bromide | 85017-82-9 | 2A-9049159 |
| 2-Chloropropionylglycine | 85038-45-5 | 2A-9049161 |
| Kidney Bean Extract | 85085-22-9 | 2A-9049176 |
| Clover extract | 85085-25-2 | 2A-9049177 |
| Yellow inhibitor HN-150 | 85095-61-0 | 2A-9049180 |
| 1-(4'-Bromobiphenyl-4-yl)-3-phenylpropenone | 85098-88-0 | 2A-0201602 |
| 1-Butyl-3-methylimidazolium bromide | 85100-77-2 | 2A-9049183 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA