
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84478-87-5 |
| Catalog No. | 2A-9049051 |
| Chinese Name | 2-溴-4-氟-5-硝基苯酚 |
| Synonyms | MFCD08460104; 2-Bromo-4-fluoro-5-nitrophenol; WNR CQ FF DE |
| Molecular Formula | C6H3BrFNO3 |
| Molecular Weight | 235.995 |
| Purity | 98.00 |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 302.4±42.0 °C at 760 mmHg |
| Appearance | White to yellow to brown solid |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2908999090 |
| PubChem ID | 39229584 |
| SMILES | O=[N+]([O-])c1cc(O)c(Br)cc1F |
| InChI | InChI=1S/C6H3BrFNO3/c7-3-1-4(8)5(9(11)12)2-6(3)10/h1-2,10H |
| InChI Key | NVNFKCCUJKPLLT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product Name: Summary 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| L-2-Aminodecanoic acid | 84277-81-6 | 2A-9049019 |
| 4-Benzyloxyphenyl acetylene | 84284-70-8 | 2A-9049020 |
| 2,7-Dibromo-9,10-phenanthrenedione | 84405-44-7 | 2A-9049034 |
| Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate | 84434-11-7 | 2A-9049037 |
| Methyl 5-cyano-2-hydroxybenzoate | 84437-12-7 | 2A-9049038 |
| 1-[1-(4-Chlorophenyl)cyclobutyl]-3-methylbutylamine hydrochloride | 84484-78-6 | 2A-9049052 |
| CERIUM MONOSULFIDE, 99 | 12014-82-3 | 2A-9049057 |
| Palm kernel oil hydrogenated | 84540-04-5 | 2A-9049059 |
| trans-4-Butyl-4'-(4-pentylcyclohexyl)-1,1'-biphenyl | 84540-36-3 | 2A-9049062 |
| trans-4-Ethyl-4'-(4-propylcyclohexyl)-1,1'-biphenyl | 84540-37-4 | 2A-9049063 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA