
CAS Number83066-88-0
Synonyms(R)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid; (2R)-2-{4-([5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid; (2R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid; Fusilade DX; (2R)-2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid; Fluazifop-P; fluazifop-P
Molecular FormulaC15H12F3NO4
Molecular Weight327.26
Purity98.00%
Density1.37 g/cm3
Boiling Point429.9ºC at 760 mmHg
Melting Point5ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83066-88-0 |
| Catalog No. | 2A-9048850 |
| Chinese Name | 精吡氟禾草灵 |
| Synonyms | (R)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid; (2R)-2-{4-([5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid; (2R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid; Fusilade DX; (2R)-2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid; Fluazifop-P; fluazifop-P |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 |
| Purity | 98.00 |
| Density | 1.37 g/cm3 |
| Boiling Point | 429.9ºC at 760 mmHg |
| Melting Point | 5ºC |
| Appearance | white powder |
| HTC | 2933399021 |
| PubChem ID | 329755138 |
| MDL Number | MFCD20036281 |
| SMILES | C[C@@H](Oc1ccc(Oc2ccc(cn2)C(F)(F)F)cc1)C(O)=O |
| InChI | 1S/C15H12F3NO4/c1-9(14(20)21)22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-9H,1H3,(H,20,21)/t9-/m1/s1 |
| InChI Key | YUVKUEAFAVKILW-SECBINFHSA-N |
| Beilstein/REAXYS | 8852807 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/48850_1_83066_88_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7,7a-Dihydro-2,2,4,6,6-pentamethyl-1,3-benzodioxol-5(6H)-one | 83020-74-0 | 2A-9048842 |
| 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-galactose | 83025-10-9 | 2A-9048843 |
| Pyridinium fluorochromate | 83042-08-4 | 2A-9048845 |
| 1H,1H,2H,2H-Perfluorodecyltrimethoxysilane | 83048-65-1 | 2A-9048846 |
| N,N'-Bis(2,5-di-tert-butylphenyl)-3,4,9,10-perylenedicarboximide | 83054-80-2 | 2A-9048847 |
| Quin-2 acetoxymethyl ester | 83104-85-2 | 2A-9048851 |
| 3-Amino-2,6-difluorobenzoic acid | 83141-11-1 | 2A-9048857 |
| Sophoridine | 83148-91-8 | 2A-9048858 |
| 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid | 83237-49-4 | 2A-9048864 |
| Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide | 83242-95-9 | 2A-9048865 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA