
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81892-72-0 |
| Catalog No. | 2A-9048673 |
| Chinese Name | 1,3-双(2,4-二氨基苯氧基)丙烷 |
| Synonyms | EINECS 279-845-4; MFCD07368624; 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 |
| Purity | 98.00 |
| Density | 1.287g/cm3 |
| Boiling Point | 574.275ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922199090 |
| PubChem ID | 14873298 |
| MDL Number | MFCD34706604 |
| SMILES | Nc1ccc(OCCCOc2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/C15H20N4O2/c16-10-2-4-14(12(18)8-10)20-6-1-7-21-15-5-3-11(17)9-13(15)19/h2-5,8-9H,1,6-7,16-19H2 |
| InChI Key | MWKPYVXITDAZLL-UHFFFAOYSA-N |
| MSDS | msds/48673_1_81892_72_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Metsulfuron | 79510-48-8 | 2A-9048346 |
| Tebuconazole | 80443-41-0 | 2A-9048478 |
| Imazapyr acid | 81334-34-1 | 2A-9048603 |
| 2,4-Dibromo-5-(trifluoromethyl)-1H-imidazole | 81654-02-6 | 2A-9048643 |
| Clomazone | 81777-89-1 | 2A-9048662 |
| 2,4-Diethyl-9H-thioxanthen-9-one | 82799-44-8 | 2A-9048807 |
| 2,4-Dibromobutyryl chloride | 82820-87-9 | 2A-9048809 |
| Bifenthrin | 83322-02-5 | 2A-9048875 |
| 2-(2,4-Dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane | 83833-32-3 | 2A-9048938 |
| 2,4-Dihydroxypyridine | 84719-31-3 | 2A-9049108 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA