
CAS Number80443-41-0
Synonyms(+)-Tebuconazole; R-tebuconazole; Fenetrazole; Ethyltrianol; Folicur; Elite; (R)-1-p-chlorophenyl-4,4-dimethyl-3-(1H-1,2,4-triazol-1-ylmethyl)pentan-3-ol; Terbuconazole; Raxil; Terbutrazole; Etiltrianol; Tebuconazole
Molecular FormulaC16H22ClN3O
Molecular Weight307.82
Purity98.00%
Density1.14 g/cm3
Boiling Point476.9ºC at 760 mmHg
Melting Point102-105ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80443-41-0 |
| Catalog No. | 2A-9048478 |
| Chinese Name | 戊唑醇 |
| Synonyms | (+)-Tebuconazole; R-tebuconazole; Fenetrazole; Ethyltrianol; Folicur; Elite; (R)-1-p-chlorophenyl-4,4-dimethyl-3-(1H-1,2,4-triazol-1-ylmethyl)pentan-3-ol; Terbuconazole; Raxil; Terbutrazole; Etiltrianol; Tebuconazole |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 |
| Purity | 98.00 |
| Density | 1.14 g/cm3 |
| Boiling Point | 476.9ºC at 760 mmHg |
| Melting Point | 102-105ºC |
| Water Solubility | 32 MG/L AT 20 ºC |
| HTC | 2933990015 |
| PubChem ID | 645499 |
| SMILES | CC(C)(C)C(O)(CCc1ccc(Cl)cc1)Cn2cncn2 |
| InChI | InChI=1S/C16H22ClN3O/c1-15(2,3)16(21,10-20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13/h4-7,11-12,21H,8-10H2,1-3H3 |
| InChI Key | InChIKey=PXMNMQRDXWABCY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| (2,4-Dioxo-1,4-dihydroquinazolin-3(2H)-yl)acetic acid | 78754-94-6 | 2A-9048268 |
| Fenoxycarb | 79127-80-3 | 2A-9048307 |
| 2-Ethylhexyl 2-(2,4-dichlorophenoxy)propionate | 79270-78-3 | 2A-9048319 |
| Thifensulfuron | 79277-67-1 | 2A-9048322 |
| Metsulfuron | 79510-48-8 | 2A-9048346 |
| Imazapyr acid | 81334-34-1 | 2A-9048603 |
| 2,4-Dibromo-5-(trifluoromethyl)-1H-imidazole | 81654-02-6 | 2A-9048643 |
| Clomazone | 81777-89-1 | 2A-9048662 |
| 1,3-Bis(2,4-diaminophenoxy)propane | 81892-72-0 | 2A-9048673 |
| 2,4-Diethyl-9H-thioxanthen-9-one | 82799-44-8 | 2A-9048807 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA