
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79694-16-9 |
| Catalog No. | 2A-9048374 |
| Chinese Name | 4-丙氧基扁桃酸 |
| Synonyms | 2-hydroxy-2-(4-propoxyphenyl)acetic acid; MFCD07368282 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| Purity | 98.00 |
| Density | 1.221 g/cm3 |
| Boiling Point | 387.1ºC at 760 mmHg |
| Melting Point | 135-137ºC |
| Appearance | white crystal |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 15912030 |
| SMILES | CCCOc1ccc(C(O)C(=O)O)cc1 |
| InChI | InChI=1S/C11H14O4/c1-2-7-15-9-5-3-8(4-6-9)10(12)11(13)14/h3-6,10,12H,2,7H2,1H3,(H,13,14) |
| InChI Key | UBHMYNPCDNGWBM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenimine | 79560-20-6 | 2A-9048359 |
| 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine hydrochloride | 79617-89-3 | 2A-9048363 |
| Di(N-succinimidyl) glutarate | 79642-50-5 | 2A-9048368 |
| 5-Bromo-2-methylbenzoic acid | 79669-49-1 | 2A-9048371 |
| Methyl 5-bromo-2-methylbenzoate | 79669-50-4 | 2A-9048372 |
| trans-1-Butoxy-4-(4-propylcyclohexyl)benzene | 79709-84-5 | 2A-9048376 |
| trans-4-Ethyl-4'-(4-pentylcyclohexyl)-1,1'-biphenyl | 79709-85-6 | 2A-9048377 |
| 1-(3-Nitro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)ethanone | 79752-03-7 | 2A-9048380 |
| MOPSO sodium salt | 79803-73-9 | 2A-9048385 |
| Ovine CRF | 79804-71-0 | 2A-9048386 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA