
CAS Number77380-28-0
Synonyms2,5-Difluorobenzenethiol; 2,5-Difluorophenyl mercaptan; Benzenethiol,2,5-difluoro; 2,5-Difluoro thiophenol; 2,4-DIFLUOROBENZOIC ACID HYDRAZIDE; SHR BF EF
Molecular FormulaC6H4S1F2
Molecular Weight146.16
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point162.4±20.0 °C at 760 mmHg
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 77380-28-0 |
| Catalog No. | 2A-9048117 |
| Chinese Name | 2,5-二氟苯硫酚 |
| Synonyms | 2,5-Difluorobenzenethiol; 2,5-Difluorophenyl mercaptan; Benzenethiol,2,5-difluoro; 2,5-Difluoro thiophenol; 2,4-DIFLUOROBENZOIC ACID HYDRAZIDE; SHR BF EF |
| Molecular Formula | C6H4S1F2 |
| Molecular Weight | 146.16 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 162.4±20.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | 2-8℃ |
| HTC | 2930909090 |
| PubChem ID | 5532666 |
| MDL Number | MFCD04973437 |
| SMILES | Fc1ccc(F)c(S)c1 |
| InChI | InChI=1S/C6H4F2S/c7-4-1-2-5(8)6(9)3-4/h1-3,9H/p-1 |
| InChI Key | PQRVQUXEBQKVEQ-UHFFFAOYSA-N |
| MSDS | msds/48117_1_77380_28_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 5-nitro-2-methylbenzoate | 77324-87-9 | 2A-9048108 |
| 2-Aminocarbonyl-3-nitrobenzoic acid | 77326-45-5 | 2A-9048110 |
| 2-Bromo-5-nitroanisole | 77337-82-7 | 2A-9048112 |
| Monomethyl succinate | 77341-67-4 | 2A-9048113 |
| 4-Nitrobenzyl hydrogen malonate | 77359-11-6 | 2A-9048115 |
| cis-4-Hydroxy-D-proline hydrochloride | 77449-94-6 | 2A-9048120 |
| Benzofluorfen | 77501-60-1 | 2A-9048127 |
| 4-Chloro-2-formylbenzonitrile | 77532-89-9 | 2A-9048134 |
| Disperse Violet 77 | 77538-14-8 | 2A-9048136 |
| Glyceryl behenate | 77538-19-3 | 2A-9048137 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA