
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75473-11-9 |
| Catalog No. | 2A-9047876 |
| Chinese Name | 1-(2-甲基-3-硝基苯基)乙酮 |
| Synonyms | 2-Methyl-3-nitrobenzophenon |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 179.17300 |
| Purity | 98.00 |
| Density | 1.201 |
| Boiling Point | 250ºC |
| Melting Point | 53-55ºC |
| HTC | 2914700090 |
| PubChem ID | 32606156 |
| MDL Number | MFCD03424514 |
| SMILES | [O-][N+](C1=C(O)C(C(C)=O)=CC(Cl)=C1C)=O |
| InChI | 1S/C9H8ClNO4/c1-4-7(10)3-6(5(2)12)9(13)8(4)11(14)15/h3,13H,1-2H3 |
| InChI Key | UQVHWGGRXQWGGY-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/47876_1_75473_11_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Dibromocyclopentene | 75415-78-0 | 2A-9047866 |
| Moxonidine hydrochloride | 75438-58-3 | 2A-9047869 |
| C16-22-Alkyldimethyl amines | 75444-69-8 | 2A-9047871 |
| 2,5-Diamino-1,4-benzenedithiol dihydrochloride | 75464-52-7 | 2A-9047873 |
| 4-Hydroxy-3-[3-oxo-1-(phenyl-D5)butyl]-2H-1-benzopyran-2-one | 75472-93-4 | 2A-9047875 |
| Cefminox | 75481-73-1 | 2A-9047877 |
| Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate | 75482-18-7 | 2A-9047878 |
| Cefminox sodium | 75498-96-3 | 2A-9047879 |
| Acetyl coenzyme A trilithium salt | 75520-41-1 | 2A-9047881 |
| Calcium chloride fluoride phosphate | 75535-31-8 | 2A-9047884 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA