
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73615-83-5 |
| Catalog No. | 2A-9047636 |
| Chinese Name | 6-甲氧基-2,3-二氢-5-甲酰基茚 |
| Synonyms | 6-methoxy-2,3-dihydro-1H-indene-5-carbaldehyde |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 |
| Purity | 98.00 |
| Density | 1.142 g/cm3 |
| Boiling Point | 317.9ºC at 760 mmHg |
| Melting Point | 72.5-73.5℃(Solv: water (7732-18-5); ethanol (64-17-5)) |
| Appearance | solid |
| Storage Condition | 2-8℃ |
| HTC | 2912499000 |
| PubChem ID | 329775817 |
| MDL Number | MFCD06248004 |
| SMILES | O=C([H])C(C(OC)=C1)=CC2=C1CCC2 |
| InChI | 1S/C11H12O2/c1-13-11-6-9-4-2-3-8(9)5-10(11)7-12/h5-7H,2-4H2,1H3 |
| InChI Key | DWWCZKVBNWJJHC-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/47636_1_73615_83_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Vinylmethylbis(methylethylketoxime)silane | 72721-10-9 | 2A-9047488 |
| Methyl 1-aminocyclopropanecarboxylate hydrochloride | 72784-42-0 | 2A-9047494 |
| Allylboronic acid pinacol ester | 72824-04-5 | 2A-9047500 |
| cis-4-(Hydroxymethyl)cyclohexanecarboxylic acid | 73094-35-6 | 2A-9047548 |
| 4-(Chloromethyl)benzaldehyde | 73291-09-5 | 2A-9047577 |
| 2,6-Dichlorophenylboronic acid | 73852-17-2 | 2A-9047663 |
| 2,4,6-Trichlorophenylboronic acid | 73852-18-3 | 2A-9047664 |
| 3,5-Bis(trifluoromethyl)benzeneboronic acid | 73852-19-4 | 2A-9047665 |
| Pyrazolo[1,5-a]pyridin-3-carbaldehyde | 73957-66-1 | 2A-9047681 |
| 3,4-Dibromobenzaldehyde | 74003-55-7 | 2A-9047687 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA