
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73291-09-5 |
| Catalog No. | 2A-9047577 |
| Chinese Name | 对氯甲基苯甲醛 |
| Synonyms | 4-(chloromethyl)benzaldehyde |
| Molecular Formula | C8H7ClO |
| Molecular Weight | 154.6 |
| Purity | 98.00 |
| Boiling Point | 265.6±15.0°C |
| Melting Point | 70-71°C |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2913000090 |
| PubChem ID | 488054 |
| SMILES | O=Cc1ccc(CCl)cc1 |
| InChI | InChI=1S/C8H7ClO/c9-5-7-1-3-8(6-10)4-2-7/h1-4,6H,5H2 |
| InChI Key | FNIFQOISPAAFQF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Trifluoromethyl)thiobenzamide | 72505-21-6 | 2A-9047458 |
| Vinylmethylbis(methylethylketoxime)silane | 72721-10-9 | 2A-9047488 |
| Methyl 1-aminocyclopropanecarboxylate hydrochloride | 72784-42-0 | 2A-9047494 |
| Allylboronic acid pinacol ester | 72824-04-5 | 2A-9047500 |
| cis-4-(Hydroxymethyl)cyclohexanecarboxylic acid | 73094-35-6 | 2A-9047548 |
| 6-Methoxy-5-indanecarbaldehyde | 73615-83-5 | 2A-9047636 |
| 2,6-Dichlorophenylboronic acid | 73852-17-2 | 2A-9047663 |
| 2,4,6-Trichlorophenylboronic acid | 73852-18-3 | 2A-9047664 |
| 3,5-Bis(trifluoromethyl)benzeneboronic acid | 73852-19-4 | 2A-9047665 |
| Pyrazolo[1,5-a]pyridin-3-carbaldehyde | 73957-66-1 | 2A-9047681 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA