
CAS Number5038-59-5
Synonyms4-(2-bromanylethanoyl)benzenesulfonyl chloride; 4-(2-bromo-acetyl)-benzenesulfonyl chloride; 4-(2-bromoacetyl)benzenesulfonic acid chloride
Molecular FormulaC8H6O3Cl1Br1S1
Molecular Weight297.56
Purity98%
Density1.742g/cm3
Boiling Point383.8ºC at 760 mmHg
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5038-59-5 |
| Catalog No. | 2A-9004763 |
| Chinese Name | 4-(2-溴乙酰基)苯磺酰氯 |
| Synonyms | 4-(2-bromanylethanoyl)benzenesulfonyl chloride; 4-(2-bromo-acetyl)-benzenesulfonyl chloride; 4-(2-bromoacetyl)benzenesulfonic acid chloride |
| Molecular Formula | C8H6O3Cl1Br1S1 |
| Molecular Weight | 297.56 |
| Purity | 98 |
| Density | 1.742g/cm3 |
| Boiling Point | 383.8ºC at 760 mmHg |
| Appearance | White to yellow solid |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| MDL Number | MFCD03424999 |
| SMILES | O=C(CBr)c1ccc(S(=O)(=O)Cl)cc1 |
| InChI Key | YSZVEXHEBFFCSK-UHFFFAOYSA-N |
| MSDS | msds/4763_1_5038_59_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 3-Nitrobenzenesulfonyl chloride | 121-51-7 | 2A-9004667 |
| 3-Nitrobenzoyl isothiocyanate | 78225-78-2 | 2A-9004671 |
| 3-Nitrophenyl isothiocyanate | 3529-82-6 | 2A-9004680 |
| 3-Piperazinyl-1,2-benzisothiazole hydrochloride | 87691-88-1 | 2A-9004722 |
| 4-(1-Piperidinyl)piperidine dihydrochloride | 4876-60-2 | 2A-9004751 |
| 4-(2'-N-Boc-pyrrole)benzoic acid | 2A-104777 | 2A-9004777 |
| 4-(2'-N-Boc-pyrrole)benzoic acid | 2A-104778 | 2A-9004778 |
| 4-(3-Oxo-3-phenylpropenyl)benzenesulfonyl chloride | 7454-09-3 | 2A-9004793 |
| 4-(Benzenesulfonyl)thiophene-2-sulfonyl chloride | 160233-28-3 | 2A-9004837 |
| 4-(Bromomethyl)benzenesulfonyl chloride | 66176-39-4 | 2A-9004846 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA