
CAS Number3529-82-6
Synonymsm-Nitrophenyl isothiocyanate; 3-Nitrophenyl isothiocyanate; ISOTHIOCYANIC ACID,m-NITROPHENYL ESTER; 1-isothiocyanato-3-nitro-benzene; Benzene,1-isothiocyanato-3-nitro; 1-nitryl-3-isothiocyanatobenzene; MFCD00041245
Molecular FormulaO2NC6H4NCS
Molecular Weight180.18
Purity98%
Density1.33g/cm3
Boiling Point317.8ºC at 760mmHg
Melting Point57-60 °C (lit.)
AppearanceSolid;White to Almost white powder to crystaline
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3529-82-6 |
| Catalog No. | 2A-9004680 |
| Chinese Name | 3-硝基异硫氰酸苯酯 |
| Synonyms | m-Nitrophenyl isothiocyanate; 3-Nitrophenyl isothiocyanate; ISOTHIOCYANIC ACID,m-NITROPHENYL ESTER; 1-isothiocyanato-3-nitro-benzene; Benzene,1-isothiocyanato-3-nitro; 1-nitryl-3-isothiocyanatobenzene; MFCD00041245 |
| Molecular Formula | O2NC6H4NCS |
| Molecular Weight | 180.18 |
| Purity | 98 |
| Density | 1.33g/cm3 |
| Boiling Point | 317.8ºC at 760mmHg |
| Melting Point | 57-60 °C (lit.) |
| Appearance | Solid;White to Almost white powder to crystaline |
| Storage Condition | Store at room temperature, away from light, in a v |
| Packaging | II |
| HTC | 2930909090 |
| PubChem ID | 24872267 |
| MDL Number | MFCD00041245 |
| SMILES | [O-][N+](=O)c1cccc(c1)N=C=S |
| InChI | 1S/C7H4N2O2S/c10-9(11)7-3-1-2-6(4-7)8-5-12/h1-4H |
| InChI Key | OEZXLKSZOAWNJU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 6.1 |
| MSDS | msds/4680_1_3529_82_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 3-N-Boc-3-(4-methylthiophenyl)propionic acid | 2A-104656 | 2A-9004656 |
| 3-N-Boc-3-(4-methylthiophenyl)propionic acid | 2A-104657 | 2A-9004657 |
| 3-N-Boc-3-phenylpropionic acid | 14676-01-8 | 2A-9004658 |
| 3-Nitrobenzenesulfonyl chloride | 121-51-7 | 2A-9004667 |
| 3-Nitrobenzoyl isothiocyanate | 78225-78-2 | 2A-9004671 |
| 3-Piperazinyl-1,2-benzisothiazole hydrochloride | 87691-88-1 | 2A-9004722 |
| 4-(1-Piperidinyl)piperidine dihydrochloride | 4876-60-2 | 2A-9004751 |
| 4-(2-Bromoacetyl)benzenesulfonyl chloride | 5038-59-5 | 2A-9004763 |
| 4-(2'-N-Boc-pyrrole)benzoic acid | 2A-104777 | 2A-9004777 |
| 4-(2'-N-Boc-pyrrole)benzoic acid | 2A-104778 | 2A-9004778 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA