
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72457-26-2 |
| Catalog No. | 2A-9047450 |
| Chinese Name | 4-(4-甲氧基苯基)丁胺 |
| Synonyms | Benzenebutanamine,4-methoxy; 4-Methoxybenzenebutanamine |
| Molecular Formula | C11H17O1N1 |
| Molecular Weight | 179.26 |
| Purity | 98.00 |
| Density | 0.979 |
| Boiling Point | 293.87ºC at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 15611934 |
| MDL Number | MFCD00870516 |
| SMILES | COc1ccc(CCCCN)cc1 |
| InChI | InChI=1S/C11H17NO/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8H,2-4,9,12H2,1H3 |
| InChI Key | USDPTYHOEKPQAN-UHFFFAOYSA-N |
| MSDS | msds/47450_1_72457_26_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-Difluorobenzylamine | 72235-53-1 | 2A-9047434 |
| [1,1'-Bis(diphenylphosphino)ferrocene]dichloropalladium(II) | 72287-26-4 | 2A-9047439 |
| Aniracetam | 72432-10-1 | 2A-9047447 |
| Ethyl allyl disulfide | 72437-63-9 | 2A-9047448 |
| 1,3-Bis(3,4-dicyanophenoxy)benzene | 72452-47-2 | 2A-9047449 |
| 1-Chloro-3-isopropoxypropane | 72468-94-1 | 2A-9047451 |
| Garenoxacin | 194804-75-6 | 2A-9047457 |
| 1-Isobutyl-4-piperidone | 72544-16-2 | 2A-9047461 |
| 3-(2-Chloroactyl)-2-[(2-chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine-2-oxide | 72578-71-3 | 2A-9047466 |
| 1-Methyl-1H-pyrazolo[3,4-b]pyridin-3-ylamine | 72583-83-6 | 2A-9047470 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA