
CAS Number68527-76-4
Synonymsethyl vanillin propylene glycol acetal; 2-Ethoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol
Molecular FormulaC12H16O4
Molecular Weight224.26
Purity95%
Density1.2±0.1 g/cm3
Boiling Point346.4±42.0 °C at 760 mmHg
AppearanceColorless to light yellow viscous liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68527-76-4 |
| Catalog No. | 2A-9046834 |
| Chinese Name | 乙基香兰素丙二醇缩醛 |
| Synonyms | ethyl vanillin propylene glycol acetal; 2-Ethoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 |
| Purity | 95 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 346.4±42.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow viscous liquid |
| Storage Condition | room temperature, dry |
| HTC | 2932999099 |
| PubChem ID | 10235062 |
| MDL Number | MFCD00036667 |
| SMILES | CCOc1cc(C2OCC(C)O2)ccc1O |
| InChI | InChI=1S/C12H16O4/c1-3-14-11-6-9(4-5-10(11)13)12-15-7-8(2)16-12/h4-6,8,12-13H,3,7H2,1-2H3 |
| InChI Key | IFUIILQWHYHIEK-UHFFFAOYSA-N |
| MSDS | msds/46834_1_68527_76_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Food Additives | ||
|---|---|---|
| Sucralose | 56038-13-2 | 2A-9044542 |
| 6-Bromovanillin | 60632-40-8 | 2A-9045359 |
| Spectinomycin sulfate tetrahydrate | 64058-48-6 | 2A-9046016 |
| Maltol isobutyrate | 65416-14-0 | 2A-9046266 |
| Vanillin propyleneglycol acetal | 68527-74-2 | 2A-9046833 |
| Maltol propionate | 68555-63-5 | 2A-9046842 |
| Citronella grass oil | 73049-78-2 | 2A-9047536 |
| Pegfilgrastim | 208265-92-3 | 2A-9055437 |
| SACCHARIN CALCIUM | 6485-34-3 | 2A-9060017 |
| Stevia extract | 2A-352451 | 2A-9060926 |
| Browse all Food Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA