
CAS Number66916-99-2
Synonyms2-(2-bromo-4-methoxyphenyl)acetic acid; MFCD02664700; (2-Bromo-4-methoxyphenyl)acetic acid
Molecular FormulaH3COC6H3(Br)CH2CO2H
Molecular Weight245.07
Purity97%
Density1.6±0.1 g/cm3
Boiling Point353.6±27.0 °C at 760 mmHg
Melting Point127-131 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 66916-99-2 |
| Catalog No. | 2A-9046493 |
| Chinese Name | 2-溴-4-甲氧基苯乙酸 |
| Synonyms | 2-(2-bromo-4-methoxyphenyl)acetic acid; MFCD02664700; (2-Bromo-4-methoxyphenyl)acetic acid |
| Molecular Formula | H3COC6H3(Br)CH2CO2H |
| Molecular Weight | 245.07 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 353.6±27.0 °C at 760 mmHg |
| Melting Point | 127-131 °C (lit.) |
| Appearance | solid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918990090 |
| PubChem ID | 24883935 |
| MDL Number | MFCD02664700 |
| SMILES | COc1ccc(CC(O)=O)c(Br)c1 |
| InChI | 1S/C9H9BrO3/c1-13-7-3-2-6(4-9(11)12)8(10)5-7/h2-3,5H,4H2,1H3,(H,11,12) |
| InChI Key | XQELSBAAFMYSMG-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/46493_1_66916_99_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,1,3-Trimethyl-2-[(1E,3Z)-3-phenyl-5-(1,1,3-trimethyl-1,3-dihydro-2H-benzo[e]indol-2-ylidene)-1,3-pentadienyl]-1H-benzo[e]indolium iodide | 66753-40-0 | 2A-9046477 |
| N-Ethyl-1-heptanamine | 66793-76-8 | 2A-9046479 |
| Almagate | 66827-12-1 | 2A-9046483 |
| Calcium 3-methyl-2-oxovalerate | 66872-75-1 | 2A-9046488 |
| 2-Chloro-5-methylnicotinic acid | 66909-30-6 | 2A-9046491 |
| Aza-15-crown-5 | 66943-05-3 | 2A-9046495 |
| N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt | 66992-27-6 | 2A-9046498 |
| Bis(vinylsulfonyl)propanol | 67006-32-0 | 2A-9046500 |
| 1,3-Bis(hydroxyethylsulfonyl)propanol | 67006-34-2 | 2A-9046501 |
| 1,3-Bis(chloroethyl sulfonyl)propanol | 67006-35-3 | 2A-9046502 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA