
CAS Number66872-75-1
SynonymsEINECS 266-505-5; Pentanoic acid, 3-methyl-2-oxo-, calcium salt (2:1); Calcium bis(3-methyl-2-oxopentanoate); MFCD00002583; Calcium 3-methyl-2-oxovalerate
Molecular FormulaCH3CH2CH(CH3)COCOONa
Molecular Weight152.12
Purity98.00%
AppearanceSolid;White to Almost white powder to crystal
EINECS266-503-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 66872-75-1 |
| Catalog No. | 2A-9046488 |
| Chinese Name | 消旋酮异亮氨酸钙 |
| Synonyms | EINECS 266-505-5; Pentanoic acid, 3-methyl-2-oxo-, calcium salt (2:1); Calcium bis(3-methyl-2-oxopentanoate); MFCD00002583; Calcium 3-methyl-2-oxovalerate |
| Molecular Formula | CH3CH2CH(CH3)COCOONa |
| Molecular Weight | 152.12 |
| Purity | 98.00 |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| EINECS | 266-503-4 |
| HTC | 2918300090 |
| PubChem ID | 24896244 |
| MDL Number | MFCD00002584 |
| SMILES | [Na+].CCC(C)C(=O)C([O-])=O |
| InChI | 1S/C6H10O3.Na/c1-3-4(2)5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChI Key | SMDJDLCNOXJGKC-UHFFFAOYSA-M |
| Beilstein/REAXYS | 7779663 |
| NACRES Code | NA.25 |
| UNSPSC | 12352211 |
| MSDS | msds/46488_1_66872_75_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5,5,5-Trifluoropentanoic acid methyl ester | 66716-19-6 | 2A-9046469 |
| 4-Isobutylcinnamic acid | 66734-95-0 | 2A-9046475 |
| 1,1,3-Trimethyl-2-[(1E,3Z)-3-phenyl-5-(1,1,3-trimethyl-1,3-dihydro-2H-benzo[e]indol-2-ylidene)-1,3-pentadienyl]-1H-benzo[e]indolium iodide | 66753-40-0 | 2A-9046477 |
| N-Ethyl-1-heptanamine | 66793-76-8 | 2A-9046479 |
| Almagate | 66827-12-1 | 2A-9046483 |
| 2-Chloro-5-methylnicotinic acid | 66909-30-6 | 2A-9046491 |
| 2-Bromo-4-methoxyphenylacetic acid | 66916-99-2 | 2A-9046493 |
| Aza-15-crown-5 | 66943-05-3 | 2A-9046495 |
| N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt | 66992-27-6 | 2A-9046498 |
| Bis(vinylsulfonyl)propanol | 67006-32-0 | 2A-9046500 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA