CAS Number1074-98-2
Synonyms3-methyl-4-nitropyridine-N-oxide; 4-Nitro-3-picoline N-Oxide; 4-Nitropyridine-N-oxide; 4-Nitro-B-picoline N-oxide; 3-methyl-4-nitro-pyridin1-oxide; 3-methyl-4-nitropyridine-l-oxide; 4-Nitropyridine-1-oxyde; EINECS 214-050-8; 4-Nitro-3-picoline 1-oxide; 3-Methyl-4-nitropyridine N-Oxide; MFCD00014626; 3-Picoline,4-nitro-,1-oxide; 4-Nitro-3-picoline-N-oxide; 3-methyl-4-nitropyridine-1-oxide; 3-Methyl-4-nitropyri; 4-Nitropyridine 1-oxide; Pyridine, 4-nitro-, 1-oxide
Molecular FormulaC6H6N2O3
Molecular Weight154.12
Purity98%
Density1.4±0.1 g/cm3
Boiling Point397.2±15.0 °C at 760 mmHg
Melting Point136-138 °C (lit.)
Appearancepowder, crystals or chunks
EINECS214-050-8
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1074-98-2 |
| Catalog No. | 2A-9004618 |
| Chinese Name | 3-甲基-4-硝基吡啶-N-氧化物 |
| Synonyms | 3-methyl-4-nitropyridine-N-oxide; 4-Nitro-3-picoline N-Oxide; 4-Nitropyridine-N-oxide; 4-Nitro-B-picoline N-oxide; 3-methyl-4-nitro-pyridin1-oxide; 3-methyl-4-nitropyridine-l-oxide; 4-Nitropyridine-1-oxyde; EINECS 214-050-8; 4-Nitro-3-picoline 1-oxide; 3-Methyl-4-nitropyridine N-Oxide; MFCD00014626; 3-Picoline,4-nitro-,1-oxide; 4-Nitro-3-picoline-N-oxide; 3-methyl-4-nitropyridine-1-oxide; 3-Methyl-4-nitropyri; 4-Nitropyridine 1-oxide; Pyridine, 4-nitro-, 1-oxide |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 397.2±15.0 °C at 760 mmHg |
| Melting Point | 136-138 °C (lit.) |
| Appearance | powder, crystals or chunks |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| Packaging | II |
| EINECS | 214-050-8 |
| HTC | 2933399090 |
| PubChem ID | 24863055 |
| MDL Number | MFCD00014626 |
| SMILES | Cc1c[n+]([O-])ccc1[N+]([O-])=O |
| InChI | 1S/C6H6N2O3/c1-5-4-7(9)3-2-6(5)8(10)11/h2-4H,1H3 |
| InChI Key | SSOURMYKACOBIV-UHFFFAOYSA-N |
| NACRES Code | NA.47 |
| UNSPSC | 12171500 |
| Hazard Symbols | 6.1 |
| Risk Codes | R20/21/22;R40 |
| Safety Description | S36/37;S45 |
| MSDS | msds/4618_1_1074_98_2.pdf |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Methyl-1-phenylpyrazole | 1128-54-7 | 2A-9004610 |
| 3-Methyl-2-(thiophene-2-carboxamido)butanoic acid | 2A-104611 | 2A-9004611 |
| 3-Methyl-2-thiophenecarbonyl chloride | 61341-26-2 | 2A-9004613 |
| 3-Methyl-2-thiophenecarboxaldehyde | 5834-16-2 | 2A-9004614 |
| 3-Methyl-2-thiophenecarboxylic acid | 23806-24-8 | 2A-9004615 |
| 3-Methylaminopiperidine dihydrochloride | 127294-77-3 | 2A-9004623 |
| 3-Methylindole | 83-34-1 | 2A-9004628 |
| 3-Methylquinoline | 612-58-8 | 2A-9004631 |
| 3-Methylthiophene | 616-44-4 | 2A-9004633 |
| 3-Nitro-1,2,4-triazole | 24807-55-4 | 2A-9004660 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS