
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1128-54-7 |
| Catalog No. | 2A-9004610 |
| Chinese Name | 3-甲基-1-苯基吡啶 |
| Synonyms | EINECS 214-438-7; 3-Methyl-1-phenylpyrazole; MFCD00003123 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.2 |
| Purity | 98 |
| Density | 1,076 g/cm3 |
| Boiling Point | 255ºC |
| Melting Point | 34-36 °C(lit.) |
| Appearance | white crystal |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2933199090 |
| MDL Number | MFCD00003123 |
| SMILES | Cc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N2/c1-9-7-8-12(11-9)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChI Key | RJXLUGSJEMSDPK-UHFFFAOYSA-N |
| MSDS | msds/4610_1_1128_54_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Methyl-1-phenylpyrazole Modification number: 5.3 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Isochromanone | 4385-35-7 | 2A-9004582 |
| 3-Mercapto-1,2,4-triazole | 3179-31-5 | 2A-9004583 |
| 3-Methoxy-2-nitropyridine | 20265-37-6 | 2A-9004594 |
| 3-Methoxy-3-indolecarboxaldehyde | 2A-104595 | 2A-9004595 |
| 3-Methoxy-4-pyridinecarboxylic acid | 654663-32-8 | 2A-9004598 |
| 3-Methyl-2-(thiophene-2-carboxamido)butanoic acid | 2A-104611 | 2A-9004611 |
| 3-Methyl-2-thiophenecarbonyl chloride | 61341-26-2 | 2A-9004613 |
| 3-Methyl-2-thiophenecarboxaldehyde | 5834-16-2 | 2A-9004614 |
| 3-Methyl-2-thiophenecarboxylic acid | 23806-24-8 | 2A-9004615 |
| 3-Methyl-4-nitropyridine-N-oxide | 1074-98-2 | 2A-9004618 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA