
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63971-25-5 |
| Catalog No. | 2A-9046001 |
| Chinese Name | 3-氨基-5,7-二甲基-金刚烷-1-醇 |
| Synonyms | 1-Amino-3,5-dimethyl-7-hydroxyadamantane; 1-AMINO-7-HYDROXY-3,5-DIMETHYLADAMANTANE; 3-Amino-5,7-dimethyl-adamantan-1-ol |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.30100 |
| Purity | 98.00 |
| Density | 1.197 g/cm3 |
| Boiling Point | 269.4ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922199090 |
| PubChem ID | 6878345 |
| SMILES | CC12CC3(C)CC(N)(C1)CC(O)(C2)C3 |
| InChI | InChI=1S/C12H21NO/c1-9-3-10(2)5-11(13,4-9)8-12(14,6-9)7-10/h14H,3-8,13H2,1-2H3 |
| InChI Key | HSRBAOBUCHCHTQ-UHFFFAOYSA-N |
| MSDS | msds/46001_1_63971_25_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,4'-Bis(3-aminophenoxy)benzophenone | 63948-92-5 | 2A-9045994 |
| 3-Amino-4-chlorobenzoic acid 2-dodecyloxy-1-methyl-2-oxoethyl ester | 63966-96-1 | 2A-9045995 |
| N-(3-(5-Mercapto-1H-tetrazol-1-yl)phenyl)benzamide | 63967-10-2 | 2A-9045996 |
| 3-Amino-4-methoxy-(3'-chloro-2'-methyl)benzanilide | 63969-05-1 | 2A-9045999 |
| Methyl 2-(2-formylphenyl)acetate | 63969-83-5 | 2A-9046000 |
| 2-(4-Bromophenyl)pyriding | 63996-36-1 | 2A-9046004 |
| 3-Cyanophenylalanine | 63999-80-4 | 2A-9046005 |
| 4-Tetrazol-1-ylphenol | 64001-11-2 | 2A-9046006 |
| 3-Aminopropanamide hydrochloride | 64017-81-8 | 2A-9046008 |
| Dipivefrin hydrochloride | 64019-93-8 | 2A-9046009 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA