
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63969-83-5 |
| Catalog No. | 2A-9046000 |
| Chinese Name | 2-(2-甲酰基苯基)乙酸甲酯 |
| Synonyms | methyl 2-formylphenylacetate; Methyl o-formylphenylacetate; 2-formyl-phenylacetic acid methyl ester |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18500 |
| Purity | 98.00 |
| Density | 1.157 |
| Boiling Point | 273.9ºC at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2918300090 |
| PubChem ID | 31501511 |
| SMILES | COC(=O)Cc1ccccc1C=O |
| InChI | InChI=1S/C10H10O3/c1-13-10(12)6-8-4-2-3-5-9(8)7-11/h2-5,7H,6H2,1H3 |
| InChI Key | HGYCMAAUZWDACG-UHFFFAOYSA-N |
| MSDS | msds/46000_1_63969_83_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Nitromethopholine | 63937-57-5 | 2A-9045993 |
| 4,4'-Bis(3-aminophenoxy)benzophenone | 63948-92-5 | 2A-9045994 |
| 3-Amino-4-chlorobenzoic acid 2-dodecyloxy-1-methyl-2-oxoethyl ester | 63966-96-1 | 2A-9045995 |
| N-(3-(5-Mercapto-1H-tetrazol-1-yl)phenyl)benzamide | 63967-10-2 | 2A-9045996 |
| 3-Amino-4-methoxy-(3'-chloro-2'-methyl)benzanilide | 63969-05-1 | 2A-9045999 |
| 1-Amino-7-hydroxy-3,5-dimethyladamantane | 63971-25-5 | 2A-9046001 |
| 2-(4-Bromophenyl)pyriding | 63996-36-1 | 2A-9046004 |
| 3-Cyanophenylalanine | 63999-80-4 | 2A-9046005 |
| 4-Tetrazol-1-ylphenol | 64001-11-2 | 2A-9046006 |
| 3-Aminopropanamide hydrochloride | 64017-81-8 | 2A-9046008 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA