
CAS Number62257-16-3
Synonyms5-hydroxy-2-fluoroaniline; 2-Fluoro-5-hydroxyaniline; ZR CQ FF; 3-amino-4-fluoro-phenol; 3-Amino-4-fluorophenol; Phenol,3-amino-4-fluoro; MFCD09033850
Molecular FormulaC6H6FNO
Molecular Weight127.12
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point269.3±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62257-16-3 |
| Catalog No. | 2A-9045685 |
| Chinese Name | 3-氨基-4-氟苯酚 |
| Synonyms | 5-hydroxy-2-fluoroaniline; 2-Fluoro-5-hydroxyaniline; ZR CQ FF; 3-amino-4-fluoro-phenol; 3-Amino-4-fluorophenol; Phenol,3-amino-4-fluoro; MFCD09033850 |
| Molecular Formula | C6H6FNO |
| Molecular Weight | 127.12 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 269.3±20.0 °C at 760 mmHg |
| Storage Condition | 2~8℃, avoid light |
| HTC | 2922299090 |
| PubChem ID | 36729467 |
| SMILES | Nc1cc(O)ccc1F |
| InChI | InChI=1S/C6H6FNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2 |
| InChI Key | VJCSFNNTQGRAKH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2,3-Triacetyl-5-deoxy-D-ribose | 62211-93-2 | 2A-9045673 |
| Diethyl 2,3-dichlorobutanedioate | 62243-26-9 | 2A-9045679 |
| 3-Amino-3-(pyridin-3-yl)propanoic acid | 62247-21-6 | 2A-9045680 |
| Epidermal Growth Factor | 62253-63-8 | 2A-9045682 |
| 2-Fluoro-5-methoxyaniline | 62257-15-2 | 2A-9045684 |
| Quinfamide | 62265-68-3 | 2A-9045687 |
| 6-Bromo-2-benzothiazolinone | 62266-82-4 | 2A-9045688 |
| 2,6-Dimethylbenzyl alcohol | 62285-58-9 | 2A-9045689 |
| Azure B eosinate | 62298-42-4 | 2A-9045691 |
| Thymosin alpha 1 | 62304-98-7 | 2A-9045693 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA