
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61563-43-7 |
| Catalog No. | 2A-9045513 |
| Chinese Name | 8-异喹啉甲酸 |
| Synonyms | 8-Isoquinolinecarboxylic acid; isoquinoline-8-carboxylic acid |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 405.6±18.0 °C at 760 mmHg |
| Appearance | Crystalline Powder | White to pale brown |
| Storage Condition | room temperature |
| HTC | 2933499090 |
| PubChem ID | 35965618 |
| SMILES | O=C(O)c1cccc2ccncc12 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-3-1-2-7-4-5-11-6-9(7)8/h1-6H,(H,12,13) |
| InChI Key | VMNZQPRIUSJCOH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Isobutyl-4-methylthiazole | 61323-24-8 | 2A-9045473 |
| Methyl 2-amino-5-phenylthiophene-3-carboxylate | 61325-02-8 | 2A-9045474 |
| 1-(3-Carboxypyrid-2-yl)-2-phenyl-4-methyl-piperazine | 61338-13-4 | 2A-9045479 |
| Bicyclo[4.1.0]heptane-7-carboxylic acid methyl ester | 61452-49-1 | 2A-9045502 |
| 8-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride | 61563-33-5 | 2A-9045512 |
| 2-Methylthieno[2,3-d]thiazole | 61612-02-0 | 2A-9045520 |
| 2-Ethoxy-4,6-dihydroxypyrimidine | 61636-08-6 | 2A-9045523 |
| 4,5-Dihydroxymethyl-2-phenylimidazole | 61698-32-6 | 2A-9045532 |
| 5-Carboxyindazole hydrochloride | 61700-61-6 | 2A-9045534 |
| 1,3-Dihydro-7-nitro-2H-imidazo[4,5-c]pyridin-2-one | 61719-60-6 | 2A-9045541 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA