
CAS Number61338-13-4
Synonyms2-(4-methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic acid; 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid; 2-(4-Methyl-2-phenylpiperazin-1-yl)nicotinic acid; 1-(3-Carboxy-2-pyridyl)-4-methyl-2-phenylpiperazine; 1-(3-Carboxypyrid-2-yl)-2-phenyl-4-methyl-piperazine
Molecular FormulaC17H19O2N3
Molecular Weight297.36
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point494.3±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61338-13-4 |
| Catalog No. | 2A-9045479 |
| Chinese Name | 米氮平酸 |
| Synonyms | 2-(4-methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic acid; 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid; 2-(4-Methyl-2-phenylpiperazin-1-yl)nicotinic acid; 1-(3-Carboxy-2-pyridyl)-4-methyl-2-phenylpiperazine; 1-(3-Carboxypyrid-2-yl)-2-phenyl-4-methyl-piperazine |
| Molecular Formula | C17H19O2N3 |
| Molecular Weight | 297.36 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 494.3±45.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933599090 |
| PubChem ID | 14800333 |
| MDL Number | MFCD08458719 |
| SMILES | CN1CCN(c2ncccc2C(=O)O)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H19N3O2/c1-19-10-11-20(15(12-19)13-6-3-2-4-7-13)16-14(17(21)22)8-5-9-18-16/h2-9,15H,10-12H2,1H3,(H,21,22) |
| InChI Key | HCVDLMUVEGPGGH-UHFFFAOYSA-N |
| MSDS | msds/45479_1_61338_13_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Fluoro-4-methoxyquinoline | 61293-17-2 | 2A-9045464 |
| 2-Amino-5-bromothiazole monohydrobromide | 61296-22-8 | 2A-9045466 |
| 2-Methyl-6-phenylbenzoxazole | 61309-99-7 | 2A-9045468 |
| 2-Isobutyl-4-methylthiazole | 61323-24-8 | 2A-9045473 |
| Methyl 2-amino-5-phenylthiophene-3-carboxylate | 61325-02-8 | 2A-9045474 |
| Bicyclo[4.1.0]heptane-7-carboxylic acid methyl ester | 61452-49-1 | 2A-9045502 |
| 8-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride | 61563-33-5 | 2A-9045512 |
| Isoquinoline-8-carboxylic acid | 61563-43-7 | 2A-9045513 |
| 2-Methylthieno[2,3-d]thiazole | 61612-02-0 | 2A-9045520 |
| 2-Ethoxy-4,6-dihydroxypyrimidine | 61636-08-6 | 2A-9045523 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA