CAS Number61434-67-1
Synonyms5-[(E)-2-(4-Hydroxyphenyl)ethenyl]benzol-1,3-diol; cis-3,4',5-trihydroxystilbene; 5-[(Z)-2-(4-Hydroxyphenyl)vinyl]benzene-1,3-diol; (E)-5-(p-Hydroxystyryl)resorcinol; 5-[(Z)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzenediol; 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol; (E)-5-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzendiol; 3,5,4'-Trihydroxy-trans-stilbene; Resveratrol,Z; 5-[(E)-2-(4-Hydroxyphenyl)vinyl]benzene-1,3-diol; cis-resveratrol; 3,4',5-trihydroxy-stilbene; Resveratrol; 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol; 5-[(E)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzenediol; 3,4',5-trihydroxystilbene; (E)-5-(4-hydroxystyryl)benzene-1,3-diol; 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol; 3,5,4'-trihydroxy-stilbene; Tocris-1418
Molecular FormulaC14H12O3
Molecular Weight228.25
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point449.1±14.0 °C at 760 mmHg
Melting Point167-170ºC (dec)
Appearanceoff-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61434-67-1 |
| Catalog No. | 2A-9045496 |
| Chinese Name | 顺式白藜芦醇 |
| Synonyms | 5-[(E)-2-(4-Hydroxyphenyl)ethenyl]benzol-1,3-diol; cis-3,4',5-trihydroxystilbene; 5-[(Z)-2-(4-Hydroxyphenyl)vinyl]benzene-1,3-diol; (E)-5-(p-Hydroxystyryl)resorcinol; 5-[(Z)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzenediol; 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol; (E)-5-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzendiol; 3,5,4'-Trihydroxy-trans-stilbene; Resveratrol,Z; 5-[(E)-2-(4-Hydroxyphenyl)vinyl]benzene-1,3-diol; cis-resveratrol; 3,4',5-trihydroxy-stilbene; Resveratrol; 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol; 5-[(E)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzenediol; 3,4',5-trihydroxystilbene; (E)-5-(4-hydroxystyryl)benzene-1,3-diol; 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol; 3,5,4'-trihydroxy-stilbene; Tocris-1418 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 449.1±14.0 °C at 760 mmHg |
| Melting Point | 167-170ºC (dec) |
| Appearance | off-white solid |
| Storage Condition | 2-8°C, inert gas |
| Application | Cis-resveratrol has significant antiviral activity. The IC50 of cis-resveratrol against coxsackievirus B3 (CVB3) and enterovirus 71 (EV71) is 12.2µM and 37.6µM respectively, and it can inhibit enterov |
| PubChem ID | 8653302 |
| MDL Number | C14H12O3 |
| SMILES | Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1- |
| InChI Key | LUKBXSAWLPMMSZ-UPHRSURJSA-N |
| MSDS | msds/45496_1_61434_67_1.pdf |
| Transport Info | Product name: cis-resveratrol |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| N-Acetyl carnosine | 56353-15-2 | 2A-9044604 |
| Clavulanic acid | 58001-44-8 | 2A-9044936 |
| Thiamine thiazolone pyrophosphate | 59733-97-0 | 2A-9045231 |
| 1alpha,25-Dihydroxyvitamin D2 | 60133-18-8 | 2A-9045294 |
| L-Ornithine acetate | 60259-81-6 | 2A-9045316 |
| 4-Amino-L-phenylalanine hydrochloride | 62040-55-5 | 2A-9045644 |
| Boc-4-Iodo-L-phenylalanine | 62129-44-6 | 2A-9045661 |
| Calcifediol | 63283-36-3 | 2A-9045886 |
| 3-Trifluoromethyl-DL-phenylalanine | 63701-37-1 | 2A-9045952 |
| Boc-N-alpha-methyl-O-benzyl-L-tyrosine | 64263-81-6 | 2A-9046066 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS