
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61303-13-7 |
| Catalog No. | 2A-9045467 |
| Chinese Name | 异麦角甾苷 |
| Synonyms | verbascoside; ISOVERBASCOSIDE; Isoacteosid; iso-Acteoside; isoacetoside |
| Molecular Formula | C29H36O15 |
| Molecular Weight | 624.59 |
| Purity | ≥90 (LC/MS-ELSD) |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 942.9±65.0 °C at 760 mmHg |
| Melting Point | 220-230℃ |
| Appearance | solid |
| Storage Condition | 2-8°C |
| Application | Isoacteoside is a natural product that can significantly inhibit the formation of glycation end products. |
| PubChem ID | 649510 |
| MDL Number | MFCD06798947 |
| SMILES | O1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1C)O)O)O)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2O)COC(=O)\C=C\c4cc(c(cc4)O)O)OCCc3cc(c(cc3)O)O)O |
| InChI | 1S/C29H36O15/c1-13-22(35)24(37)25(38)29(42-13)44-27-23(36)20(12-41-21(34)7-4-14-2-5-16(30)18(32)10-14)43-28(26(27)39)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27-,28+,29-/m0/s1 |
| InChI Key | FNMHEHXNBNCPCI-QEOJJFGVSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352205 |
| MSDS | msds/45467_1_61303_13_7.pdf |
| Transport Info | Product name: Isoeugenol glycosides |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Dodecyl-beta-D-glucopyranoside | 59122-55-3 | 2A-9045117 |
| Cholesterol-26,26,26,27,27,27-D6 | 60816-17-3 | 2A-9045387 |
| Cyanomethyl 2,3,4,6-tetra-O-acetyl-1-thio-beta-D-galactopyranoside | 61145-33-3 | 2A-9045429 |
| Verbascoside | 61276-17-3 | 2A-9045456 |
| Schisandrin A | 61281-38-7 | 2A-9045462 |
| Ginsenoside F2 | 62025-49-4 | 2A-9045641 |
| Pinoresinol diglucoside | 63902-38-5 | 2A-9045984 |
| 3-Carboxyumbelliferyl beta-D-galactopyranoside | 64664-99-9 | 2A-9046129 |
| Neomangiferin | 64809-67-2 | 2A-9046150 |
| Vitexin-2-O-rhamnoside | 64820-99-1 | 2A-9046152 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA