
CAS Number60816-17-3
Synonyms4,6-Diamino-2-<2-nitro-phenyl>-1,3,5-triazin; <26,27-2H6>cholesterol; D6-cholesterol; 2-o-Nitrophenyl-4,6-diamino-s-triazin
Molecular FormulaC27H40D6O
Molecular Weight392.69
Purity>99 (TLC)%
Density1.003 g/cm3
Boiling Point360ºC
Melting Point147-149ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60816-17-3 |
| Catalog No. | 2A-9045387 |
| Chinese Name | 胆固醇-26,26,26,27,27,27-D6 |
| Synonyms | 4,6-Diamino-2-<2-nitro-phenyl>-1,3,5-triazin; <26,27-2H6>cholesterol; D6-cholesterol; 2-o-Nitrophenyl-4,6-diamino-s-triazin |
| Molecular Formula | C27H40D6O |
| Molecular Weight | 392.69 |
| Purity | >99 (TLC) |
| Density | 1.003 g/cm3 |
| Boiling Point | 360ºC |
| Melting Point | 147-149ºC |
| Appearance | powder |
| Application | Cholesterol-d6 is deuterium-labeled cholesterol. Cholesterol is the major sterol in mammals, accounting for 20-25% of the structural components of the plasma membrane. The plasma membrane is highly pe |
| PubChem ID | 16926242 |
| MDL Number | MFCD00201281 |
| SMILES | O[C@H]1CC[C@@]2([C@@H]3[C@H]([C@H]4[C@@]([C@H](CC4)[C@@H](CCCC(C([2H])([2H])[2H])C([2H])([2H])[2H])C)(CC3)C)CC=C2C1)C |
| InChI | InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1/i1D3,2D3 |
| InChI Key | HVYWMOMLDIMFJA-QSOBUISFSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 41141804 |
| Transport Info | Product Name: Cholesterol-d6 |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Benzyl 4,6-O-benzylidene-alpha-D-galactopyranoside | 57783-86-5 | 2A-9044902 |
| Licochalcone A | 58749-22-7 | 2A-9045064 |
| Decyl-beta-D-glucopyranoside | 58846-77-8 | 2A-9045073 |
| Hexyl beta-D-glucopyranoside | 59080-45-4 | 2A-9045107 |
| Dodecyl-beta-D-glucopyranoside | 59122-55-3 | 2A-9045117 |
| Cyanomethyl 2,3,4,6-tetra-O-acetyl-1-thio-beta-D-galactopyranoside | 61145-33-3 | 2A-9045429 |
| Verbascoside | 61276-17-3 | 2A-9045456 |
| Schisandrin A | 61281-38-7 | 2A-9045462 |
| Isoacteoside | 61303-13-7 | 2A-9045467 |
| Ginsenoside F2 | 62025-49-4 | 2A-9045641 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA