
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59808-52-5 |
| Catalog No. | 2A-9045250 |
| Chinese Name | 2-苯基嘧啶-5-胺 |
| Synonyms | 2-Phenyl-pyrimidin-5-ylamin; 5-Amino-2-phenyl-pyrimidin; 5-amino-2-phenylpyrimidine; F2124-0470; 2-Phenyl-pyrimidin-5-ylamine |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.2 |
| Purity | 98.00 |
| Density | 1.193g/cm3 |
| Boiling Point | 246.2ºC at 760 mmHg |
| Storage Condition | 2-8°C, avoid light and dry |
| HTC | 2933599090 |
| PubChem ID | 3296582 |
| MDL Number | MFCD00520252 |
| SMILES | Nc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C10H9N3/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-7H,11H2 |
| InChI Key | YUPYDSQWLFBBJJ-UHFFFAOYSA-N |
| MSDS | msds/45250_1_59808_52_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Ethoxy-3-nitrobenzoic acid | 59719-77-6 | 2A-9045226 |
| Camostat mesilate | 59721-29-8 | 2A-9045228 |
| Benzo[b]thiophen-10-methoxycycloheptanone | 59743-84-9 | 2A-9045232 |
| Fluridone | 59756-60-4 | 2A-9045236 |
| L-Histidyl-L-prolinamide dihydrobromide | 59760-04-2 | 2A-9045237 |
| N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol | 59820-43-8 | 2A-9045252 |
| [1,3-Bis(diphenylphosphino)propane]palladium(II) dichloride | 59831-02-6 | 2A-9045256 |
| Isopropyl ferulate | 59831-94-6 | 2A-9045257 |
| Ammonium dodecanedioate | 59864-79-8 | 2A-9045263 |
| 4-Phenoxy-2',2'-dichloroacetophenone | 59867-68-4 | 2A-9045265 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA