
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59719-77-6 |
| Catalog No. | 2A-9045226 |
| Chinese Name | 4-乙氧基-3-硝基苯甲酸 |
| Synonyms | 4-Aethoxy-3-nitro-benzoesaeure; 4-Ethoxy-3-nitro-benzoic acid |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| Purity | 98.00 |
| Density | 1.368 g/cm3 |
| Boiling Point | 378.6ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329827037 |
| MDL Number | MFCD01143607 |
| SMILES | [O-][N+](C1=CC(C(O)=O)=CC=C1OCC)=O |
| InChI | 1S/C9H9NO5/c1-2-15-8-4-3-6(9(11)12)5-7(8)10(13)14/h3-5H,2H2,1H3,(H,11,12) |
| InChI Key | GZHXYRWGRKIXEJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/45226_1_59719_77_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-amino-4-(((2,5-dichlorophenyl)amino)carbonyl)benzoate | 59673-82-4 | 2A-9045217 |
| (3-Aminophenyl)-urea monohydrochloride | 59690-88-9 | 2A-9045218 |
| N-(4-Aminophenyl)propanamide | 59690-89-0 | 2A-9045219 |
| 1-Methylpiperazin-2-one | 59702-07-7 | 2A-9045220 |
| 1,3-Cyclopentanediol | 59719-74-3 | 2A-9045225 |
| Camostat mesilate | 59721-29-8 | 2A-9045228 |
| Benzo[b]thiophen-10-methoxycycloheptanone | 59743-84-9 | 2A-9045232 |
| Fluridone | 59756-60-4 | 2A-9045236 |
| L-Histidyl-L-prolinamide dihydrobromide | 59760-04-2 | 2A-9045237 |
| 2-Phenylpyrimidin-5-amine | 59808-52-5 | 2A-9045250 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA