
CAS Number59662-31-6
Synonyms4-Hexylbiphenyl; 4-Hexyl-diphenyl; MFCD00009527; EINECS 261-845-0; 4-hexyl-1-phenylbenzene; 4-n-Hexylbiphenyl; 4-Hexyl-1,1'-biphenyl
Molecular FormulaC18H22
Molecular Weight238.367
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point351.7±12.0 °C at 760 mmHg
Melting Point29 °C
AppearanceWhite to light yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59662-31-6 |
| Catalog No. | 2A-9045212 |
| Chinese Name | 4-正己基联苯 |
| Synonyms | 4-Hexylbiphenyl; 4-Hexyl-diphenyl; MFCD00009527; EINECS 261-845-0; 4-hexyl-1-phenylbenzene; 4-n-Hexylbiphenyl; 4-Hexyl-1,1'-biphenyl |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.367 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 351.7±12.0 °C at 760 mmHg |
| Melting Point | 29 °C |
| Appearance | White to light yellow solid |
| Storage Condition | Store in a sealed container in a cool, dry place |
| HTC | 2902909090 |
| PubChem ID | 3138686 |
| SMILES | CCCCCCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22/c1-2-3-4-6-9-16-12-14-18(15-13-16)17-10-7-5-8-11-17/h5,7-8,10-15H,2-4,6,9H2,1H3 |
| InChI Key | XRPVQXPWEVJKTN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2902909090 other aromatic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 2.0%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-5-methoxyaniline | 59557-92-5 | 2A-9045197 |
| Phenyl(2-pyridyl)methylamine hydrochloride | 59575-91-6 | 2A-9045199 |
| Etiproston | 59619-81-7 | 2A-9045206 |
| Imexon | 59643-91-3 | 2A-9045209 |
| Telluric acid | 11120-48-2 | 2A-9045211 |
| 4-Heptylbiphenyl | 59662-32-7 | 2A-9045213 |
| 3-tert-Butylisoxazol-5-ylamine | 59669-59-9 | 2A-9045216 |
| Methyl 2-amino-4-(((2,5-dichlorophenyl)amino)carbonyl)benzoate | 59673-82-4 | 2A-9045217 |
| (3-Aminophenyl)-urea monohydrochloride | 59690-88-9 | 2A-9045218 |
| N-(4-Aminophenyl)propanamide | 59690-89-0 | 2A-9045219 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA