
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57648-21-2 |
| Catalog No. | 2A-9044877 |
| Chinese Name | 替米哌隆 |
| Synonyms | EINECS 260-880-9; DD 3480; Tolopelon; timiperone |
| Molecular Formula | C22H24FN3OS |
| Molecular Weight | 397.50900 |
| Purity | 98.00 |
| Density | 1.31 |
| Boiling Point | 560.8ºC at 760 mmHg |
| Melting Point | 201-203ºC |
| Application | Timiperone has a strong affinity for the brain's dopamine D2 receptors. Timiperone has antipsychotic activity and inhibits stereotyped behaviors. Timiperone could be used in schizophrenia research |
| EINECS | 260-880-9 |
| PubChem ID | 5653389 |
| SMILES | O=C(CCCN1CCC(n2c(=S)[nH]c3ccccc32)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3OS/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28) |
| InChI Key | YDLQKLWVKKFPII-UHFFFAOYSA-N |
| Transport Info | Product Name: Tetrahydro Cortisone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,3-Dimethoxypropanenitrile | 57597-62-3 | 2A-9044871 |
| 2-Ethyl-3-methoxybenzoic acid | 57598-51-3 | 2A-9044872 |
| 1,3-Propanediol bis(4-aminobenzoate) | 57609-64-0 | 2A-9044873 |
| 4-[2-[5-[4-(Diethylamino)phenyl]-4,5-dihydro-1-phenyl-1H-pyrazol-3-yl]vinyl]-N,N-diethylaniline | 57609-72-0 | 2A-9044874 |
| Methyl 2,2-dimethylphenylacetate | 57625-74-8 | 2A-9044876 |
| 3-(3-Methyl-1H-indol-1-yl)propanoic acid | 57662-47-2 | 2A-9044879 |
| Pentaethylene glycol monobenzyl ether | 57671-28-0 | 2A-9044880 |
| 2-Carbomethoxybenzenesulfonamide | 57683-71-3 | 2A-9044882 |
| Acid Black 172 | 57693-14-8 | 2A-9044883 |
| 1'-Hydroxybufuralol | 57704-16-2 | 2A-9044886 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA