
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57598-51-3 |
| Catalog No. | 2A-9044872 |
| Chinese Name | 2-乙基-3-甲氧基苯甲酸 |
| Synonyms | 2-Ethyl-3-methoxybenzoic acid |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 292.5±20.0 °C at 760 mmHg |
| Appearance | Solid |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 38556192 |
| SMILES | CCc1c(OC)cccc1C(=O)O |
| InChI | InChI=1S/C10H12O3/c1-3-7-8(10(11)12)5-4-6-9(7)13-2/h4-6H,3H2,1-2H3,(H,11,12) |
| InChI Key | RXCOEMMGBRUEEG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Amineptine | 57574-09-1 | 2A-9044862 |
| Methyltin tris(isooctyl thioglycollate) | 57583-34-3 | 2A-9044865 |
| Methyltin mercaptide | 57583-35-4 | 2A-9044866 |
| Tetraphenyl resorcinol bis(diphenylphosphate) | 57583-54-7 | 2A-9044867 |
| 3,3-Dimethoxypropanenitrile | 57597-62-3 | 2A-9044871 |
| 1,3-Propanediol bis(4-aminobenzoate) | 57609-64-0 | 2A-9044873 |
| 4-[2-[5-[4-(Diethylamino)phenyl]-4,5-dihydro-1-phenyl-1H-pyrazol-3-yl]vinyl]-N,N-diethylaniline | 57609-72-0 | 2A-9044874 |
| Methyl 2,2-dimethylphenylacetate | 57625-74-8 | 2A-9044876 |
| Timiperone | 57648-21-2 | 2A-9044877 |
| 3-(3-Methyl-1H-indol-1-yl)propanoic acid | 57662-47-2 | 2A-9044879 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA