
CAS Number56253-90-8
Synonyms(2,3,4,5,6-H)Phenylalanine; L-Phenylalanine-d5; Phenylalanine-2,3,4,5,6-d; L-Phenyl-D5-alanine
Molecular FormulaC6D5CH2CH(NH2)CO2H
Molecular Weight170.22
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point307.5±30.0 °C at 760 mmHg
Melting Point270-275 °C (dec. )(lit.)
AppearanceWhite to off-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56253-90-8 |
| Catalog No. | 2A-9044581 |
| Chinese Name | L-苯基-D5-丙氨酸 |
| Synonyms | (2,3,4,5,6-H)Phenylalanine; L-Phenylalanine-d5; Phenylalanine-2,3,4,5,6-d; L-Phenyl-D5-alanine |
| Molecular Formula | C6D5CH2CH(NH2)CO2H |
| Molecular Weight | 170.22 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 307.5±30.0 °C at 760 mmHg |
| Melting Point | 270-275 °C (dec. )(lit.) |
| Appearance | White to off-white solid |
| Storage Condition | 2-8°C |
| Application | L-phenylalanine d5 is deuterium-labeled L-phenylalanine. L-phenylalanine ((S)-2-amino-3-phenylalanine) is an essential amino acid isolated from Escherichia coli. L-phenylalanine is the α2δ subunit of |
| PubChem ID | 85390870 |
| SMILES | NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D |
| InChI Key | COLNVLDHVKWLRT-HRVDQBBZSA-N |
| Transport Info | Product name: L-phenylalanine-d5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichloro-4-pyridone-N-acetic acid | 56187-37-2 | 2A-9044568 |
| Cefazedone | 56187-47-4 | 2A-9044569 |
| Dibasic lead stearate | 56189-09-4 | 2A-9044570 |
| Tetrapropylammonium bisulfate | 56211-70-2 | 2A-9044574 |
| 2-Nitro-N-methylbenzylamine | 56222-08-3 | 2A-9044575 |
| N-Hexadecanoyl-L-alanine | 56255-31-3 | 2A-9044582 |
| 4-Bromo-3-methoxybenzoic acid | 56256-14-5 | 2A-9044583 |
| 2,5-Dimethoxy-4-bromophenethylamine hydrochloride | 56281-37-9 | 2A-9044587 |
| 2-(Fluoromethyl)-3-(2-methylphenyl)-6-nitro-3H-quinazolin-4-one | 56287-73-1 | 2A-9044588 |
| Afloqualone | 56287-74-2 | 2A-9044589 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA