![Methyl 2-[4-(chlorosulfonyl)phenoxy]acetate structure, CAS 56077-78-2](/structures/60000/44551_1_56077_78_2.png)
CAS Number56077-78-2
SynonymsMethyl [4-(chlorosulfonyl)phenoxy]acetate; Acetic acid, 2-[4-(chlorosulfonyl)phenoxy]-, methyl ester; fd7132
Molecular FormulaC9H9ClO5S
Molecular Weight264.683
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point381.5±17.0 °C at 760 mmHg
Melting Point63-64ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56077-78-2 |
| Catalog No. | 2A-9044551 |
| Chinese Name | 2-[4-(氯磺酰基)苯氧基]乙酸甲酯 |
| Synonyms | Methyl [4-(chlorosulfonyl)phenoxy]acetate; Acetic acid, 2-[4-(chlorosulfonyl)phenoxy]-, methyl ester; fd7132 |
| Molecular Formula | C9H9ClO5S |
| Molecular Weight | 264.683 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 381.5±17.0 °C at 760 mmHg |
| Melting Point | 63-64ºC |
| HTC | 2918990090 |
| PubChem ID | 38641092 |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C9H9ClO5S/c1-14-9(11)6-15-7-2-4-8(5-3-7)16(10,12)13/h2-5H,6H2,1H3 |
| InChI Key | ISHZBFTYSQSGBF-UHFFFAOYSA-N |
| MSDS | msds/44551_1_56077_78_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isopentyl phenethyl ether | 56011-02-0 | 2A-9044539 |
| Methyl 6-(hydroxymethyl)nicotinate | 56026-36-9 | 2A-9044540 |
| N-(1-Ethylpropyl)-3,4-dimethylaniline | 56038-89-2 | 2A-9044543 |
| Chromate(1-)-51cr, ((N,N'-1,2-ethanediylbis(N-(carboxymethyl)glycinato))(4-)-N,N',o,o',on,on')-, sodium | 12558-57-5 | 2A-9044544 |
| 2-Amino-6-methylbenzonitrile | 56043-01-7 | 2A-9044546 |
| 4-Fluoro-2-iodobenzoic acid | 56096-89-0 | 2A-9044552 |
| 4-(tert-Butyl)benzamide | 56108-12-4 | 2A-9044554 |
| 1-Benzyl-4-(4-chlorophenyl)-4-piperidinol | 56108-25-9 | 2A-9044555 |
| 1-Benzyl-4-(3-trifuoromethyl)phenyl-4-piperdinol | 56108-27-1 | 2A-9044556 |
| 1-(3-Pyridyl)ethylamine | 56129-55-6 | 2A-9044559 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA