
CAS Number56038-89-2
SynonymsN-(1-Ethylpropyl)-3,4-dimethylbenzenamine; N-3-pentyl-3,4-dimethylaniline; 3,4-Dimethyl-N-(pentan-3-yl)aniline; DSSTox_CID_8040; 2Y2&MR C1 D1
Molecular FormulaC13H21N
Molecular Weight191.313
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point290.2±9.0 °C at 760 mmHg
AppearanceRed-brown to brown liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56038-89-2 |
| Catalog No. | 2A-9044543 |
| Chinese Name | N-(1-乙基丙基)-3,4-二甲基苯胺 |
| Synonyms | N-(1-Ethylpropyl)-3,4-dimethylbenzenamine; N-3-pentyl-3,4-dimethylaniline; 3,4-Dimethyl-N-(pentan-3-yl)aniline; DSSTox_CID_8040; 2Y2&MR C1 D1 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.313 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 290.2±9.0 °C at 760 mmHg |
| Appearance | Red-brown to brown liquid |
| Storage Condition | 2-8°C, protected from light, dry |
| HTC | 2942000000 |
| PubChem ID | 10225135 |
| SMILES | CCC(CC)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H21N/c1-5-12(6-2)14-13-8-7-10(3)11(4)9-13/h7-9,12,14H,5-6H2,1-4H3 |
| InChI Key | ZOTRFGNOTDLOAU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sutan E | 55947-96-1 | 2A-9044526 |
| Kathon 886 | 55965-84-9 | 2A-9044530 |
| 3-[(4-Amino-3-methylphenyl)azo]benzenesulfonic acid | 55994-13-3 | 2A-9044537 |
| Isopentyl phenethyl ether | 56011-02-0 | 2A-9044539 |
| Methyl 6-(hydroxymethyl)nicotinate | 56026-36-9 | 2A-9044540 |
| Chromate(1-)-51cr, ((N,N'-1,2-ethanediylbis(N-(carboxymethyl)glycinato))(4-)-N,N',o,o',on,on')-, sodium | 12558-57-5 | 2A-9044544 |
| 2-Amino-6-methylbenzonitrile | 56043-01-7 | 2A-9044546 |
| Methyl 2-[4-(chlorosulfonyl)phenoxy]acetate | 56077-78-2 | 2A-9044551 |
| 4-Fluoro-2-iodobenzoic acid | 56096-89-0 | 2A-9044552 |
| 4-(tert-Butyl)benzamide | 56108-12-4 | 2A-9044554 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA