
CAS Number55150-29-3
Synonyms2-Ethoxy-1-naphthoyl Chloride; EINECS 259-502-5; 2-ethoxynaphthoyl chloride; 2-ethoxynaphthalenyl-1-carbonyl chloride; 2-ethoxy-1-naphtoyl chloride; 2-ethoxy-naphthalene-1-carbonyl chloride; MFCD00046426
Molecular FormulaC5H7O2N2Cl1
Molecular Weight162.58
Purity98.00%
Density1.232 g/cm3
Boiling Point376.4ºC at 760 mmHg
Melting Point76-80°C
Appearancepowder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55150-29-3 |
| Catalog No. | 2A-9044343 |
| Chinese Name | 2-乙氧基-1-萘甲酰氯 |
| Synonyms | 2-Ethoxy-1-naphthoyl Chloride; EINECS 259-502-5; 2-ethoxynaphthoyl chloride; 2-ethoxynaphthalenyl-1-carbonyl chloride; 2-ethoxy-1-naphtoyl chloride; 2-ethoxy-naphthalene-1-carbonyl chloride; MFCD00046426 |
| Molecular Formula | C5H7O2N2Cl1 |
| Molecular Weight | 162.58 |
| Purity | 98.00 |
| Density | 1.232 g/cm3 |
| Boiling Point | 376.4ºC at 760 mmHg |
| Melting Point | 76-80°C |
| Appearance | powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 2918990090 |
| PubChem ID | 3185915 |
| MDL Number | MFCD24558359 |
| SMILES | CCOc1ccc2ccccc2c1C(=O)Cl |
| InChI | InChI=1S/C13H11ClO2/c1-2-16-11-8-7-9-5-3-4-6-10(9)12(11)13(14)15/h3-8H,2H2,1H3 |
| InChI Key | ZRVFFIXOCFUHDA-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/44343_1_55150_29_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Nalmefene | 55096-26-9 | 2A-9044330 |
| 2-Chloro-6-fluorobenzyl chloride | 55117-15-2 | 2A-9044333 |
| Calcium trifluoromethanesulfonate | 55120-75-7 | 2A-9044334 |
| 9-Bromo-9-phenylfluorene | 55135-66-5 | 2A-9044337 |
| Nickel methane sulfonate | 55136-38-4 | 2A-9044338 |
| 6-Fluorotryptamine hydrochloride | 55206-24-1 | 2A-9044348 |
| 2-Hydroxyphenyl phenyl sulfide | 55214-86-3 | 2A-9044349 |
| Davercin | 55224-05-0 | 2A-9044352 |
| Disperse Orange 61 | 55281-26-0 | 2A-9044361 |
| Ethalfluralin | 55283-68-6 | 2A-9044362 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA