
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55092-47-2 |
| Catalog No. | 2A-9044328 |
| Chinese Name | 5-氯戊基苯甲酸酯 |
| Synonyms | benzoic acid-(5-chloro-pentyl ester); 1-benzoyloxy-5-chloropentane; Benzoesaeure-(5-chlor-pentylester) |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.705 |
| Purity | 98.00 |
| Density | 1.107 g/cm3 |
| Boiling Point | 320ºC at 760 mmHg |
| HTC | 2916310090 |
| PubChem ID | 439799 |
| MDL Number | MFCD00013695 |
| SMILES | O=C(OCCCCCCl)c1ccccc1 |
| InChI | InChI=1S/C12H15ClO2/c13-9-5-2-6-10-15-12(14)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChI Key | XIOZPPYPTAEPGJ-UHFFFAOYSA-N |
| MSDS | msds/44328_1_55092_47_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Methylpiperazino)-1,2-benzenediamine | 54998-08-2 | 2A-9044313 |
| Cloprostenol sodium | 55028-72-3 | 2A-9044314 |
| 3-Methyl-5-phenylpentan-1-ol | 55066-48-3 | 2A-9044321 |
| Glycerol phosphate disodium salt hydrate | 55073-41-1 | 2A-9044323 |
| 1-(4-Chlorophenyl)piperazin-2-one | 55083-85-7 | 2A-9044327 |
| 2,3,5-Tri-O-benzyl-D-ribonolactone | 55094-52-5 | 2A-9044329 |
| Nalmefene | 55096-26-9 | 2A-9044330 |
| 2-Chloro-6-fluorobenzyl chloride | 55117-15-2 | 2A-9044333 |
| Calcium trifluoromethanesulfonate | 55120-75-7 | 2A-9044334 |
| 9-Bromo-9-phenylfluorene | 55135-66-5 | 2A-9044337 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA