
CAS Number54589-54-7
SynonymsMFCD06200832; Ethyl 3-(chloromethyl)benzoate; Benzoic acid, 3-(chloromethyl)-, ethyl ester
Molecular FormulaC10H11ClO2
Molecular Weight198.65
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point292.3±23.0 °C at 760 mmHg
Appearancepowder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54589-54-7 |
| Catalog No. | 2A-9044231 |
| Chinese Name | 3-氯甲基苯甲酸乙酯 |
| Synonyms | MFCD06200832; Ethyl 3-(chloromethyl)benzoate; Benzoic acid, 3-(chloromethyl)-, ethyl ester |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 292.3±23.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2916399090 |
| PubChem ID | 39769651 |
| SMILES | CCOC(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C10H11ClO2/c1-2-13-10(12)9-5-3-4-8(6-9)7-11/h3-6H,2,7H2,1H3 |
| InChI Key | ZJNVMXXFCNKXLT-UHFFFAOYSA-N |
| Hazard Symbols | Category 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: III |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-(2-Trifluoromethylphenyl)-2-nitroethylene | 53960-62-6 | 2A-9044091 |
| Dimethyl [2-oxo-3-[3-(trifluoromethyl)phenoxy]propyl]phosphonate | 54094-19-8 | 2A-9044132 |
| 3-Benzyloxycyclobutane-1,1-dicarboxylic acid diethyl ester | 54166-15-3 | 2A-9044143 |
| 4-Methoxy-2,3,6-trimethylbenzaldehyde | 54344-92-2 | 2A-9044181 |
| 2-Iodo-4-trifluoromethylbenzoic acid | 54507-44-7 | 2A-9044215 |
| 8-Amino-1,4-dioxaspiro[4.5]decane-8-carboxylic acid | 54621-18-0 | 2A-9044240 |
| Tartaric acid dihydrazide | 54789-92-3 | 2A-9044274 |
| Nonanal diethyl acetal | 54815-13-3 | 2A-9044278 |
| Octanal diethyl acetal | 54889-48-4 | 2A-9044287 |
| 3-Aminoisonicotinaldehyde | 55279-29-3 | 2A-9044359 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA