CAS Number54166-15-3
Synonymsdiethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate; 3-Benzyloxy-cyclobutan-1,1-dicarbonsaeure-diaethylester; diethylester of 3-benzyloxycyclobutane-1,1-dicarboxylic acid; Diethyl 3-benzyloxy-1,1-cyclobutanedicarboxylate; 1,1-Cyclobutanedicarboxylic acid, 3-(phenylmethoxy)-, diethyl ester; Diethyl 3-(benzyloxy)-1,1-cyclobutanedicarboxylate; 1-Benzyloxy-3,3-bis-carbethoxy-cyclobutane; 3-Benzyloxy cyclobutane-1,1-dicarboxylic acid diethyl ester
Molecular FormulaC17H22O5
Molecular Weight306.362
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point368.3±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54166-15-3 |
| Catalog No. | 2A-9044143 |
| Chinese Name | 3-(苄氧基)环丁烷-1,1-二甲酸二乙酯 |
| Synonyms | diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate; 3-Benzyloxy-cyclobutan-1,1-dicarbonsaeure-diaethylester; diethylester of 3-benzyloxycyclobutane-1,1-dicarboxylic acid; Diethyl 3-benzyloxy-1,1-cyclobutanedicarboxylate; 1,1-Cyclobutanedicarboxylic acid, 3-(phenylmethoxy)-, diethyl ester; Diethyl 3-(benzyloxy)-1,1-cyclobutanedicarboxylate; 1-Benzyloxy-3,3-bis-carbethoxy-cyclobutane; 3-Benzyloxy cyclobutane-1,1-dicarboxylic acid diethyl ester |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.362 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 368.3±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918990090 |
| PubChem ID | 29201173 |
| MDL Number | MFCD07700259 |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H22O5/c1-3-20-15(18)17(16(19)21-4-2)10-14(11-17)22-12-13-8-6-5-7-9-13/h5-9,14H,3-4,10-12H2,1-2H3 |
| InChI Key | OSQKNXLJUGYQHW-UHFFFAOYSA-N |
| MSDS | msds/44143_1_54166_15_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Hexapotassium dihydrogen [hexane-1,6-diylbis[nitrilobis(methylene)]]tetrakisphosphonate | 53473-28-2 | 2A-9043997 |
| 3-[4-(Trifluoromethyl)phenyl]propanoic acid | 53473-36-2 | 2A-9043998 |
| 3-Trifluoromethylthiobenzamide | 53515-17-6 | 2A-9044006 |
| 1-(2-Trifluoromethylphenyl)-2-nitroethylene | 53960-62-6 | 2A-9044091 |
| Dimethyl [2-oxo-3-[3-(trifluoromethyl)phenoxy]propyl]phosphonate | 54094-19-8 | 2A-9044132 |
| 4-Methoxy-2,3,6-trimethylbenzaldehyde | 54344-92-2 | 2A-9044181 |
| 2-Iodo-4-trifluoromethylbenzoic acid | 54507-44-7 | 2A-9044215 |
| Ethyl 3-chloromethylbenzoate | 54589-54-7 | 2A-9044231 |
| 8-Amino-1,4-dioxaspiro[4.5]decane-8-carboxylic acid | 54621-18-0 | 2A-9044240 |
| Tartaric acid dihydrazide | 54789-92-3 | 2A-9044274 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS