
CAS Number54381-08-7
Synonymshcorange1; 4'-hydroxy-2-nitrodiphenylamine; MFCD00239470; N-o-Nitrophenyl-1,4-aminophenol; EINECS 259-132-4; iacute; HC ORANGE NO 1; 2-nitro-4'-hydroxydiphenylamine
Molecular FormulaC12H10N2O3
Molecular Weight230.21900
Purity98.00%
Density1.388 g/cm3
Boiling Point384.9ºC at 760 mmHg
Melting Point143-145ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54381-08-7 |
| Catalog No. | 2A-9044186 |
| Chinese Name | 染料橙1 |
| Synonyms | hcorange1; 4'-hydroxy-2-nitrodiphenylamine; MFCD00239470; N-o-Nitrophenyl-1,4-aminophenol; EINECS 259-132-4; iacute; HC ORANGE NO 1; 2-nitro-4'-hydroxydiphenylamine |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.21900 |
| Purity | 98.00 |
| Density | 1.388 g/cm3 |
| Boiling Point | 384.9ºC at 760 mmHg |
| Melting Point | 143-145ºC |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 5564123 |
| SMILES | [H+].[I-][Pb+2]([I-])[I-].N=CN |
| InChI | InChI=1S/CH4N2.3HI.Pb/c2-1-3;;;;/h1H,(H3,2,3);3*1H;/q;;;;+2/p-2 |
| InChI Key | HSDSBIUUVWRHTM-UHFFFAOYSA-N |
| MSDS | msds/44186_1_54381_08_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Amsacrine hydrochloride | 54301-15-4 | 2A-9044172 |
| Benzyl 3-bromopropyl ether | 54314-84-0 | 2A-9044173 |
| N-Acetyl-L-thioproline | 54323-50-1 | 2A-9044175 |
| N,N-Diethyl-2-chloropropionamide | 54333-75-4 | 2A-9044178 |
| Meptazinol | 54340-58-8 | 2A-9044180 |
| 4,4'-Dichlorodiphenic acid | 54389-65-0 | 2A-9044189 |
| 4,4'-Dibromodiphenic acid | 54389-67-2 | 2A-9044190 |
| 4,5:4',5'-Dibenzo-1,1',3,3,3',3'-hexamethylindadicarbocyanine perchlorate | 54389-98-9 | 2A-9044191 |
| 2-Nitro-4-(propylthio)aniline | 54393-89-4 | 2A-9044192 |
| 4-Amino-3-bromobenzotrifluoride | 54403-97-3 | 2A-9044197 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA